Feedback

3-maleylpyruvate

Properties
MNX_IDMNXM2190
formulaC7H4O6
charge-2
mass184.10306
referencechebi:16727
Image of MNXM2190
InChIKeyAZCFLHZUFANAOR-UPHRSURJSA-L
InChIInChI=1S/C7H6O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h1-2H,3H2,(H,10,11)(H,12,13)/p-2/b2-1-
SMILES[O-]C(=O)\C=C/C(=O)CC(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref5
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
sabiorkM:2375 3-Maleylpyruvate
Maleylpyruvate
Maleylpyruvic acid
seedM:cpd01466 Maleylpyruvate
(2Z)-4,6-dioxohept-2-enedioate
3-Maleylpyruvate
3-maleylpyruvate
Maleylpyruvic acid
maleylpyruvate
maleylpyruvic acid
chebi:16727 3-maleylpyruvate
(2Z)-4,6-dioxohept-2-enedioate
3-maleylpyruvate(2-)
chebi:30859 3-maleylpyruvic acid
(2Z)-4,6-dioxohept-2-enedioic acid
Maleylpyruvate
Maleylpyruvic acid
chebi:11845
chebi:14562
chebi:25126
chebi:25127
chebi:6655
keggC:M_C02167
seedM:M_cpd01466
secondary/obsolete/fantasy identifier
lipidmaps:LMFA01170065 3-maleylpyruvic acid
4,6-dioxo-2Z-heptenedioic acid
Maleylpyruvate
Maleylpyruvic acid
metacycM:CPD-1070 3-maleylpyruvate
(2Z)-4,6-dioxohept-2-enedioate
maleylpyruvate
maleylpyruvic acid
keggC:C02167 Maleylpyruvate
3-Maleylpyruvate
Maleylpyruvic acid