Feedback

3-maleylpyruvate

PropertiesImageOccurences in reactions
MNX_IDMNXM2190Image of MNXM2190
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC7H4O6
charge-2
mass184.10306
referencechebi:16727
InChIKeyAZCFLHZUFANAOR-UPHRSURJSA-L
InChIInChI=1S/C7H6O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h1-2H,3H2,(H,10,11)(H,12,13)/p-2/b2-1-
SMILES[O-]C(=O)\C=C/C(=O)CC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16727
chebi:16727
3-maleylpyruvate
(2Z)-4,6-dioxohept-2-enedioate
3-maleylpyruvate(2-)
sabiork.compound:2375
sabiorkM:2375
3-Maleylpyruvate
Maleylpyruvate
Maleylpyruvic acid
metacyc.compound:CPD-1070
metacycM:CPD-1070
3-maleylpyruvate
(2Z)-4,6-dioxohept-2-enedioate
maleylpyruvate
maleylpyruvic acid
CHEBI:30859
chebi:30859
3-maleylpyruvic acid
(2Z)-4,6-dioxohept-2-enedioic acid
Maleylpyruvate
Maleylpyruvic acid
lipidmaps:LMFA01170065
lipidmapsM:LMFA01170065
3-maleylpyruvic acid
4,6-dioxo-2Z-heptenedioic acid
Maleylpyruvate
Maleylpyruvic acid
seed.compound:cpd01466
seedM:cpd01466
Maleylpyruvate
(2Z)-4,6-dioxohept-2-enedioate
3-Maleylpyruvate
3-maleylpyruvate
Maleylpyruvic acid
maleylpyruvate
maleylpyruvic acid
kegg.compound:C02167
keggC:C02167
Maleylpyruvate
3-Maleylpyruvate
Maleylpyruvic acid
chebi:11845
chebi:14562
chebi:25126
chebi:25127
chebi:6655
keggC:M_C02167
seedM:M_cpd01466
secondary/obsolete/fantasy identifier