Feedback

glycolate

PropertiesImageOccurences in reactions
MNX_IDMNXM222Image of MNXM222
#reac
in my sandbox 0
in MNXref (generic)62
in models (compartimentalized) 43
formulaC2H3O3
charge-1
mass75.00877
referencechebi:29805
InChIKeyAEMRFAOFKBGASW-UHFFFAOYSA-M
InChIInChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/p-1
SMILESO=C([O-])CO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-389822
reactomeM:R-ALL-389822
CHEBI:29805
chebi:29805
glycolate
hydroxyacetate
bigg.metabolite:glyclt
biggM:glyclt
envipath:...8591a6b78f5f
envipathM:...8591a6b78f5f
Glycolate
sabiork.compound:1953
sabiorkM:1953
kegg.compound:C00160
keggC:C00160
Glycolate
Glycolic acid
Hydroxyacetic acid
seed.compound:cpd00139
seedM:cpd00139
Glycolate
Glycolic acid
Hydroxyacetic acid
glyclt
glycolate
glycolic acid
glycollate
hydroxyacetic acid
hmdb:HMDB0000115 Glycolic acid
2-Hydroxyacetate
2-Hydroxyacetic acid
2-Hydroxyethanoate
2-Hydroxyethanoic acid
2-hydroxyacetic acid
GlyPure
GlyPure 70
Glycocide
Glycolate
Glycolic acid, 1-(14)C-labeled
Glycolic acid, 2-(14)C-labeled
Glycolic acid, calcium salt
Glycolic acid, monoammonium salt
Glycolic acid, monolithium salt
Glycolic acid, monopotassium salt
Glycolic acid, monosodium salt
Glycolic acid, potassium salt
Glycollate
Glycollic acid
HOCH2COOH
Hydroxyacetate
Hydroxyacetic acid
Hydroxyethanoate
Hydroxyethanoic acid
Potassium glycolate
Sodium glycolate
a-Hydroxyacetate
a-Hydroxyacetic acid
alpha-Hydroxyacetate
alpha-Hydroxyacetic acid
alpha-hydroxyacetate
alpha-hydroxyacetic acid
glycolic acid
metacyc.compound:Ketoaldonates
metacycM:Ketoaldonates
a ketoaldonate
a ketoaldonic acid
envipath:...43ad453f2124
envipathM:...43ad453f2124
compound 2541
envipath:...d4ce30c862bf
envipathM:...d4ce30c862bf
compound 37958
envipath:...7515166e2965
envipathM:...7515166e2965
compound 680
metacyc.compound:GLYCOLLATE
metacycM:GLYCOLLATE
glycolate
glycolic acid
glycollate
hydroxyacetic acid
CHEBI:17497
chebi:17497
glycolic acid
2-Hydroxyacetic acid
2-Hydroxyethanoic acid
GLYCOLIC ACID
Glycolic acid
Glycollic acid
HOCH2COOH
Hydroxyacetic acid
Hydroxyethanoic acid
alpha-Hydroxyacetic acid
alpha-hydroxyacetic acid
hydroxyacetic acid
seed.compound:cpd12347
seedM:cpd12347
omega-Hydroxy fatty acid
hmdb:HMDB0003035
hmdb:HMDB00115
hmdb:HMDB03035
chebi:14348
chebi:24388
chebi:24390
chebi:42865
chebi:5475
biggM:M_glyclt
keggC:M_C00160
seedM:M_cpd00139
seedM:M_cpd12347
secondary/obsolete/fantasy identifier