Feedback

hydroxymalonate

Properties
MNX_IDMNXM2238
formulaC3H2O5
charge-2
mass118.04498
referencechebi:17649
Image of MNXM2238
InChIKeyROBFUDYVXSDBQM-UHFFFAOYSA-L
InChIInChI=1S/C3H4O5/c4-1(2(5)6)3(7)8/h1,4H,(H,5,6)(H,7,8)/p-2
SMILESOC(C([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
metacycM:HYDROXYMALONATE 2-hydroxymalonate
hydroxymalonate
tartronate
envipath:...ed9867ae9cb0 compound 38002
sabiorkM:2402 Hydroxymalonate
Hydroxymalonic acid
Tartronic acid
chebi:11598
chebi:1163
chebi:14422
chebi:19645
chebi:19646
chebi:26851
chebi:46268
chebi:5808
hmdb:HMDB35227
keggC:M_C02287
seedM:M_cpd01539
seedM:M_cpd28655
secondary/obsolete/fantasy identifier
envipath:...32596d82ab1b compound 789
chebi:30844 hydroxymalonate(1-)
carboxy(hydroxy)acetate
hmdb:HMDB0035227 Hydroxypropanedioic acid
2-Hydroxymalonate
2-Hydroxymalonic acid
2-Hydroxypropanedioate
2-Hydroxypropanedioic acid
2-Tartronate
2-Tartronic acid
2-hydroxypropanedioic acid
Hydroxy-malonic acid
Hydroxymalonate
Hydroxymalonic acid
Hydroxypropanedioate
Propanedioic acid, hydroxy- (9ci)
Tartronate
Tartronic acid
Tartronic acid, 8ci
tartronic acid
seedM:cpd28655 2-hydroxymalonate
tartronate
chebi:16513 hydroxymalonic acid
2-Hydroxymalonate
2-Hydroxymalonic acid
2-Tartronic acid
2-hydroxypropanedioic acid
Hydroxymalonic acid
Tartronic acid
hydroxypropanedioic acid
seedM:cpd01539 Tartronic acid
2-Hydroxymalonate
2-Hydroxymalonic acid
2-Tartronic acid
2-hydroxymalonate
Hydroxymalonate
Hydroxymalonic acid
hydroxymalonate
tartronate
chebi:17649 hydroxymalonate
TARTRONATE
hydroxymalonate(2-)
hydroxypropanedioate
keggC:C02287 Hydroxymalonate
2-Hydroxymalonate
2-Hydroxymalonic acid
2-Tartronic acid
Hydroxymalonic acid
Tartronic acid
envipath:...1ac2e19cc6fb P06
chebi:24711 hydroxymalonate
hydroxymalonate anion
hydroxymalonic acid anion
tartronate
MNXM527271is deprecated and replaced by this entry
MNXM724012is deprecated and replaced by this entry
MNXM724456is deprecated and replaced by this entry
MNXM725108is deprecated and replaced by this entry