Feedback

hydroxymalonate

PropertiesImageOccurences in reactions
MNX_IDMNXM2238Image of MNXM2238
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC3H2O5
charge-2
mass118.04498
referencechebi:17649
InChIKeyROBFUDYVXSDBQM-UHFFFAOYSA-L
InChIInChI=1S/C3H4O5/c4-1(2(5)6)3(7)8/h1,4H,(H,5,6)(H,7,8)/p-2
SMILESOC(C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17649
chebi:17649
hydroxymalonate
TARTRONATE
hydroxymalonate(2-)
hydroxypropanedioate
metacyc.compound:HYDROXYMALONATE
metacycM:HYDROXYMALONATE
2-hydroxymalonate
hydroxymalonate
tartronate
seed.compound:cpd28655
seedM:cpd28655
2-hydroxymalonate
tartronate
kegg.compound:C02287
keggC:C02287
Hydroxymalonate
2-Hydroxymalonate
2-Hydroxymalonic acid
2-Tartronic acid
Hydroxymalonic acid
Tartronic acid
sabiork.compound:2402
sabiorkM:2402
Hydroxymalonate
Hydroxymalonic acid
Tartronic acid
hmdb:HMDB0035227 Hydroxypropanedioic acid
2-Hydroxymalonate
2-Hydroxymalonic acid
2-Hydroxypropanedioate
2-Hydroxypropanedioic acid
2-Tartronate
2-Tartronic acid
2-hydroxypropanedioic acid
Hydroxy-malonic acid
Hydroxymalonate
Hydroxymalonic acid
Hydroxypropanedioate
Propanedioic acid, hydroxy- (9ci)
Tartronate
Tartronic acid
Tartronic acid, 8ci
tartronic acid
envipath:...1ac2e19cc6fb
envipathM:...1ac2e19cc6fb
P06
seed.compound:cpd01539
seedM:cpd01539
Tartronic acid
2-Hydroxymalonate
2-Hydroxymalonic acid
2-Tartronic acid
2-hydroxymalonate
Hydroxymalonate
Hydroxymalonic acid
hydroxymalonate
tartronate
envipath:...ed9867ae9cb0
envipathM:...ed9867ae9cb0
compound 38002
envipath:...32596d82ab1b
envipathM:...32596d82ab1b
compound 789
CHEBI:30844
chebi:30844
hydroxymalonate(1-)
carboxy(hydroxy)acetate
CHEBI:24711
chebi:24711
hydroxymalonate
hydroxymalonate anion
hydroxymalonic acid anion
tartronate
CHEBI:16513
chebi:16513
hydroxymalonic acid
2-Hydroxymalonate
2-Hydroxymalonic acid
2-Tartronic acid
2-hydroxypropanedioic acid
Hydroxymalonic acid
Tartronic acid
hydroxypropanedioic acid
hmdb:HMDB35227
chebi:11598
chebi:1163
chebi:14422
chebi:19645
chebi:19646
chebi:26851
chebi:46268
chebi:5808
keggC:M_C02287
seedM:M_cpd01539
seedM:M_cpd28655
secondary/obsolete/fantasy identifier