|
![]() |
InChIKey | ROBFUDYVXSDBQM-UHFFFAOYSA-L |
InChI | InChI=1S/C3H4O5/c4-1(2(5)6)3(7)8/h1,4H,(H,5,6)(H,7,8)/p-2 |
SMILES | OC(C([O-])=O)C([O-])=O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 2 |
Distinct compatimentalized reactions in models | 0 |
Identifier | Description |
---|---|
metacycM:HYDROXYMALONATE | 2-hydroxymalonate hydroxymalonate tartronate |
envipath:...ed9867ae9cb0 | compound 38002 |
sabiorkM:2402 | Hydroxymalonate Hydroxymalonic acid Tartronic acid |
chebi:11598 chebi:1163 chebi:14422 chebi:19645 chebi:19646 chebi:26851 chebi:46268 chebi:5808 hmdb:HMDB35227 keggC:M_C02287 seedM:M_cpd01539 seedM:M_cpd28655 | secondary/obsolete/fantasy identifier |
envipath:...32596d82ab1b | compound 789 |
chebi:30844 | hydroxymalonate(1-) carboxy(hydroxy)acetate |
hmdb:HMDB0035227 | Hydroxypropanedioic acid 2-Hydroxymalonate 2-Hydroxymalonic acid 2-Hydroxypropanedioate 2-Hydroxypropanedioic acid 2-Tartronate 2-Tartronic acid 2-hydroxypropanedioic acid Hydroxy-malonic acid Hydroxymalonate Hydroxymalonic acid Hydroxypropanedioate Propanedioic acid, hydroxy- (9ci) Tartronate Tartronic acid Tartronic acid, 8ci tartronic acid |
seedM:cpd28655 | 2-hydroxymalonate tartronate |
chebi:16513 | hydroxymalonic acid 2-Hydroxymalonate 2-Hydroxymalonic acid 2-Tartronic acid 2-hydroxypropanedioic acid Hydroxymalonic acid Tartronic acid hydroxypropanedioic acid |
seedM:cpd01539 | Tartronic acid 2-Hydroxymalonate 2-Hydroxymalonic acid 2-Tartronic acid 2-hydroxymalonate Hydroxymalonate Hydroxymalonic acid hydroxymalonate tartronate |
chebi:17649 | hydroxymalonate TARTRONATE hydroxymalonate(2-) hydroxypropanedioate |
keggC:C02287 | Hydroxymalonate 2-Hydroxymalonate 2-Hydroxymalonic acid 2-Tartronic acid Hydroxymalonic acid Tartronic acid |
envipath:...1ac2e19cc6fb | P06 |
chebi:24711 | hydroxymalonate hydroxymalonate anion hydroxymalonic acid anion tartronate |
MNXM527271 | is deprecated and replaced by this entry |
MNXM724012 | is deprecated and replaced by this entry |
MNXM724456 | is deprecated and replaced by this entry |
MNXM725108 | is deprecated and replaced by this entry |