Feedback

L-homolanthionine

PropertiesImageOccurences in reactions
MNX_IDMNXM2243Image of MNXM2243
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC8H16N2O4S
charge0
mass236.28972
referencechebi:62856
InChIKeyMBEPFGPQVBIIES-WDSKDSINSA-N
InChIInChI=1S/C8H16N2O4S/c9-5(7(11)12)1-3-15-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6-/m0/s1
SMILES[NH3+][C@@H](CCSCC[C@H]([NH3+])C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-1614594
reactomeM:R-ALL-1614594
CHEBI:62856
chebi:62856
L-homolanthionine
(2S,2'S)-4,4'-sulfanediylbis(2-aminobutanoic acid)
(S,S)-2,2'-diamino-4,4'-sulfanediyldibutyric acid
L-Homolanthionin
S-[(3S)-3-amino-3-carboxypropyl]-L-homocysteine
homolanthionine
seed.compound:cpd32731
seedM:cpd32731
(S,S)-2,2'-diamino-4,4'-sulfanediyldibutyric acid
L-homolanthionine
homolanthionine
sabiork.compound:29651
sabiorkM:29651
L-Homolanthionine
metacyc.compound:CPD66-96
metacycM:CPD66-96
L-homolanthionine
(S,S)-2,2'-diamino-4,4'-sulfanediyldibutyric acid
homolanthionine
seedM:M_cpd32731 secondary/obsolete/fantasy identifier