Feedback

L-rhamnonate

PropertiesImageOccurences in reactions
MNX_IDMNXM2248Image of MNXM2248
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC6H11O6
charge-1
mass179.14794
referencechebi:58118
InChIKeyNBFWIISVIFCMDK-QMKXCQHVSA-M
InChIInChI=1S/C6H12O6/c1-2(7)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H3,(H,11,12)/p-1/t2-,3-,4+,5+/m0/s1
SMILESC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58118
chebi:58118
L-rhamnonate
L-rhamnonate anion
L-rhamnonate(1-)
kegg.compound:C01934
keggC:C01934
L-Rhamnonate
6-Deoxy-L-mannonic acid
seed.compound:cpd01328
seedM:cpd01328
L-Rhamnonate
6-Deoxy-L-mannonic acid
L-rhamnonate
metacyc.compound:L-RHAMNONATE
metacycM:L-RHAMNONATE
L-rhamnonate
CHEBI:17357
chebi:17357
L-rhamnonic acid
6-deoxy-L-mannonic acid
L-Rhamnonate
chebi:13158
chebi:21375
chebi:6290
keggC:M_C01934
seedM:M_cpd01328
secondary/obsolete/fantasy identifier