Feedback

loganate

Properties
MNX_IDMNXM2252
formulaC16H23O10
charge-1
mass375.34782
referencechebi:18052
Image of MNXM2252
InChIKeyJNNGEAWILNVFFD-CDJYTOATSA-M
InChIInChI=1S/C16H24O10/c1-5-8(18)2-6-7(14(22)23)4-24-15(10(5)6)26-16-13(21)12(20)11(19)9(3-17)25-16/h4-6,8-13,15-21H,2-3H2,1H3,(H,22,23)/p-1/t5-,6+,8-,9+,10+,11+,12-,13+,15-,16-/m0/s1
SMILESC[C@H]1[C@@H](O)C[C@H]2[C@@H]1[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OC=C2C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref12
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:18052 loganate
(1S,4aS,6S,7R,7aS)-1-(beta-D-glucopyranosyloxy)-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
chebi:14524
chebi:25067
chebi:25068
chebi:6512
keggC:M_C01512
seedM:M_cpd01069
secondary/obsolete/fantasy identifier
chebi:30632 loganic acid
(1S,4aS,6S,7R,7aS)-1-(beta-D-glucopyranosyloxy)-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid
Loganic acid
keggC:C01512 Loganate
Loganic acid
metacycM:LOGANATE loganate
loganic acid
seedM:cpd01069 Loganate
Loganic acid
loganate
loganic acid