Feedback

loganate

PropertiesImageOccurences in reactions
MNX_IDMNXM2252Image of MNXM2252
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 0
formulaC16H23O10
charge-1
mass375.34782
referencechebi:18052
InChIKeyJNNGEAWILNVFFD-CDJYTOATSA-M
InChIInChI=1S/C16H24O10/c1-5-8(18)2-6-7(14(22)23)4-24-15(10(5)6)26-16-13(21)12(20)11(19)9(3-17)25-16/h4-6,8-13,15-21H,2-3H2,1H3,(H,22,23)/p-1/t5-,6+,8-,9+,10+,11+,12-,13+,15-,16-/m0/s1
SMILESC[C@H]1[C@@H](O)C[C@H]2[C@@H]1[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OC=C2C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:18052
chebi:18052
loganate
(1S,4aS,6S,7R,7aS)-1-(beta-D-glucopyranosyloxy)-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
kegg.compound:C01512
keggC:C01512
Loganate
Loganic acid
seed.compound:cpd01069
seedM:cpd01069
Loganate
Loganic acid
loganate
loganic acid
metacyc.compound:LOGANATE
metacycM:LOGANATE
loganate
loganic acid
CHEBI:30632
chebi:30632
loganic acid
(1S,4aS,6S,7R,7aS)-1-(beta-D-glucopyranosyloxy)-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid
Loganic acid
chebi:14524
chebi:25067
chebi:25068
chebi:6512
keggC:M_C01512
seedM:M_cpd01069
secondary/obsolete/fantasy identifier