Feedback

N-acetyl-D-glucosaminate

PropertiesImageOccurences in reactions
MNX_IDMNXM2262Image of MNXM2262
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC8H14NO7
charge-1
mass236.1993
referencechebi:38439
InChIKeyLZKNVSNNPRQZJB-DBRKOABJSA-M
InChIInChI=1S/C8H15NO7/c1-3(11)9-5(8(15)16)7(14)6(13)4(12)2-10/h4-7,10,12-14H,2H2,1H3,(H,9,11)(H,15,16)/p-1/t4-,5-,6-,7-/m1/s1
SMILESCC(=O)N[C@H]([C@@H](O)[C@H](O)[C@H](O)CO)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:38439
chebi:38439
N-acetyl-D-glucosaminate
2-acetamido-2-deoxy-D-gluconate
N-Acetyl-D-glucosaminate
kegg.compound:C01133
keggC:C01133
N-Acetyl-D-glucosaminate
seed.compound:cpd00833
seedM:cpd00833
N-Acetyl-D-glucosaminate
N-acetyl-D-glucosaminate
Nacetyl-D-glucosaminic acid
metacyc.compound:CPD-370
metacycM:CPD-370
N-acetyl-D-glucosaminate
Nacetyl-D-glucosaminic acid
CHEBI:16948
chebi:16948
N-acetyl-D-glucosaminic acid
(3R,4S,5R)-N-acetyl-3,4,5,6-tetrahydroxynorleucine
2-acetamido-2-deoxy-D-gluconic acid
chebi:12454
chebi:12562
chebi:21516
chebi:38438
chebi:57960
chebi:7122
keggC:M_C01133
seedM:M_cpd00833
secondary/obsolete/fantasy identifier