Feedback

 

N-acetyl-D-muramate

Image of MNXM2263
Properties
MNX_IDMNXM2263
formulaC11H18NO8
charge-1
mass292.2631
referencechebi:28881
InChIKeyMNLRQHMNZILYPY-MKFCKLDKSA-M
InChIInChI=1S/C11H19NO8/c1-4(10(16)17)19-9-7(12-5(2)14)11(18)20-6(3-13)8(9)15/h4,6-9,11,13,15,18H,3H2,1-2H3,(H,12,14)(H,16,17)/p-1/t4-,6-,7-,8-,9-,11?/m1/s1
SMILESC[C@@H](O[C@H]1[C@H](O)[C@@H](CO)OC(O)[C@@H]1NC(C)=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-acetyl-D-muramate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:acmum N-Acetylmuramate
chebi:21615 2-acetamido-3-O-[(1R)-1-carboxyethyl]-2-deoxy-D-glucopyranose
2-acetamido-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose
MNLRQHMNZILYPY-MKFCKLDKSA-N
N-Acetyl-D-muramoate
N-Acetylmuramic acid
chebi:28881
chebi:7212
2-acetamido-3-O-[(1R)-1-carboxylatoethyl]-2-deoxy-D-glucopyranose
MNLRQHMNZILYPY-MKFCKLDKSA-M
N-Acetylmuramate
N-acetyl-D-muramate
chebi:47965 2-(acetylamino)-3-O-[(1R)-1-carboxyethyl]-2-deoxy-D-glucose
2-acetamido-3-O-[(1R)-1-carboxyethyl]-2-deoxy-D-glucose
N-acetylmuramic acid
acetylmuramic acid
chebi:47978 2-acetamido-3-O-[(1R)-1-carboxylatoethyl]-2-deoxy-D-glucose
N-acetylmuramate
hmdb:HMDB60493 (2R)-2-{[(3R,4R,5S,6R)-2,5-dihydroxy-3-[(1-hydroxyethylidene)amino]-6-(hydroxymethyl)oxan-4-yl]oxy}propanoic acid
N-Acetylmuramate
kegg:C02713 N-Acetyl-D-muramoate
N-Acetylmuramate
N-Acetylmuramic acid
metacyc:NACMUR 2-[3-acetylamino-2,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxypropanoic acid
2-acetamido-3-O-(D-1-carboxyethyl)-2-deoxy-beta-D-glucose
MurNAc
N-acetylmuramate
N-acetylmuramic acid
NACMUR
NAcMur
seed:cpd01757 N-Acetylmuramate
N-Acetylmuramic acid
acmum
deprecated:MNXM63566
deprecated:MNXM91244
deprecated:MNXM95368