Feedback

N-formylanthranilate

PropertiesImageOccurences in reactions
MNX_IDMNXM2265Image of MNXM2265
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 2
formulaC8H6NO3
charge-1
mass164.13818
referencechebi:18410
InChIKeyLLLPDUXGHXIXIW-UHFFFAOYSA-M
InChIInChI=1S/C8H7NO3/c10-5-9-7-4-2-1-3-6(7)8(11)12/h1-5H,(H,9,10)(H,11,12)/p-1
SMILES[O-]C(=O)c1ccccc1NC=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:18410
chebi:18410
N-formylanthranilate
2-(formylamino)benzoate
2-formamidobenzoate
Formylanthranilate
N-Formylanthranilate
N-formylanthranilate anion
sabiork.compound:8040
sabiorkM:8040
kegg.compound:C05653
keggC:C05653
Formylanthranilate
2-(Formylamino)-benzoic acid
N-Formylanthranilate
seed.compound:cpd03364
seedM:cpd03364
Formylanthranilate
2-(Formylamino)-benzoic acid
N-Formylanthranilate
N-formylanthranilate
hmdb:HMDB0004089 Formylanthranilic acid
2-(formylamino)-Benzoate
2-(formylamino)-Benzoic acid
2-(formylamino)Benzoate
2-(formylamino)Benzoic acid
2-Formamidobenzoate
2-Formamidobenzoic acid
2-formamidobenzoic acid
Formylanthranilate
N-Formylanthranilate
formylanthranilic acid
bigg.metabolite:nformanth
biggM:nformanth
N-Formylanthranilate
metacyc.compound:N-FORMYLANTHRANILATE
metacycM:N-FORMYLANTHRANILATE
N-formylanthranilate
CHEBI:36575
chebi:36575
N-formylanthranilic acid
2-(Formylamino)-benzoic acid
2-(Formylamino)benzoic acid
hmdb:HMDB04089
chebi:12508
chebi:19417
chebi:21716
chebi:5154
biggM:M_nformanth
keggC:M_C05653
seedM:M_cpd03364
secondary/obsolete/fantasy identifier