Feedback

3-(3,5-diiodo-4-hydroxyphenyl)pyruvate

Properties
MNX_IDMNXM2296
formulaC9H4I2O4
charge-2
mass429.9346
referencechebi:58023
Image of MNXM2296
InChIKeyTZPLBTUUWSVGCY-UHFFFAOYSA-L
InChIInChI=1S/C9H6I2O4/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,13H,3H2,(H,14,15)/p-2
SMILES[O-]C(=O)C(=O)Cc1cc(I)c([O-])c(I)c1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd00915 3,5-Diiodo-4-hydroxyphenylpyruvate
3,5-diiodo-4-hydroxyphenylpyruvate
3-(3,5-Diiodo-4-hydroxyphenyl)pyruvate
3-(3,5-diiodo-4-hydroxyphenyl)pyruvate
beta-(3,5-diiodo-4-hydroxyphenyl)pyruvate
diiodo-4-hydroxyphenylpyruvate
chebi:17131 (3,5-diiodo-4-hydroxyphenyl)pyruvic acid
3,5-Diiodo-4-hydroxyphenylpyruvate
3-(3,5-Diiodo-4-hydroxyphenyl)pyruvate
3-(4-hydroxy-3,5-diiodophenyl)-2-oxopropanoic acid
beta-(3,5-diiodo-4-hydroxyphenyl)pyruvate
metacycM:DIIODO-4-HYDROXYPHENYLPYRUVATE diiodo-4-hydroxyphenylpyruvate
3,5-diiodo-4-hydroxyphenylpyruvate
3-(3,5-diiodo-4-hydroxyphenyl)pyruvate
beta-(3,5-diiodo-4-hydroxyphenyl)pyruvate
chebi:58023 3-(3,5-diiodo-4-hydroxyphenyl)pyruvate
(3,5-diiodo-4-oxidophenyl)pyruvate
(3,5-diiodo-4-oxidophenyl)pyruvate dianion
(3,5-diiodo-4-oxidophenyl)pyruvate(2-)
3-(3,5-diiodo-4-oxidophenyl)-2-oxopropanoate
keggC:C01244
sabiorkM:5470
3,5-Diiodo-4-hydroxyphenylpyruvate
3-(3,5-Diiodo-4-hydroxyphenyl)pyruvate
hmdb:HMDB0059637 3-(3,5-Diiodo-4-hydroxyphenyl)pyruvate
(3,5-diiodo-4-Hydroxyphenyl)pyruvate
3,5-diiodo-4-Hydroxyphenylpyruvate
3,5-diiodo-4-Hydroxyphenylpyruvic acid
3-(3,5-diiodo-4-Hydroxyphenyl)pyruvate
3-(3,5-diiodo-4-Hydroxyphenyl)pyruvic acid
3-(4-hydroxy-3,5-diiodophenyl)-2-oxopropanoic acid
Hydroxydiiodophenylpyruvic acid
b-(3,5-diiodo-4-Hydroxyphenyl)pyruvate
b-(3,5-diiodo-4-Hydroxyphenyl)pyruvic acid
beta-(3,5-diiodo-4-Hydroxyphenyl)pyruvate
beta-(3,5-diiodo-4-Hydroxyphenyl)pyruvic acid
beta-(3,5-diiodo-4-hydroxyphenyl)pyruvate
beta-(3,5-diiodo-4-hydroxyphenyl)pyruvic acid
chebi:11709
chebi:11723
chebi:1404
chebi:19908
hmdb:HMDB59637
keggC:M_C01244
seedM:M_cpd00915
secondary/obsolete/fantasy identifier
MNXM91934is deprecated and replaced by this entry