Feedback

(3R)-beta-leucine

Properties
MNX_IDMNXM2297
formulaC6H13NO2
charge0
mass131.17296
referencechebi:57428
Image of MNXM2297
InChIKeyGLUJNGJDHCTUJY-RXMQYKEDSA-N
InChIInChI=1S/C6H13NO2/c1-4(2)5(7)3-6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1
SMILESCC(C)[C@H]([NH3+])CC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
metacycM:CPD-2041 (3R)-beta-leucine
(3R)-beta-2-amino-4-methylvaleric acid
3-amino-4-methylpentanoate
L-beta-leucine
beta-homovaline
beta-leucine
chebi:15604 (3R)-beta-leucine
(3R)-3-Amino-4-methylpentanoic acid
(3R)-3-Amino-4-methylvaleric acid
(3R)-3-amino-4-methylpentanoic acid
(3R)-beta-2-amino-4-methylvaleric acid
(3R)-beta-Leucine
L-beta-Leucine
seedM:cpd01634 L-beta-Leucine
(3R)-3-Amino-4-methylpentanoic acid
(3R)-3-Amino-4-methylvaleric acid
(3R)-beta-2-Amino-4-methylvaleric acid
(3R)-beta-2-amino-4-methylvaleric acid
(3R)-beta-Leucine
(3R)-beta-leucine
3-amino-4-methylpentanoate
L-beta-leucine
beta-homovaline
beta-leucine
chebi:57428 (3R)-beta-leucine
(3R)-3-azaniumyl-4-methylpentanoate
(3R)-beta-leucine zwitterion
beta-leucine zwitterion
chebi:10884
chebi:205
chebi:21252
keggC:M_C02486
seedM:M_cpd01634
secondary/obsolete/fantasy identifier
keggC:C02486 (3R)-beta-Leucine
(3R)-3-Amino-4-methylpentanoic acid
(3R)-3-Amino-4-methylvaleric acid