Feedback

pyruvate

PropertiesImageOccurences in reactions
MNX_IDMNXM23Image of MNXM23
#reac
in my sandbox 0
in MNXref (generic)722
in models (compartimentalized) 423
formulaC3H3O3
charge-1
mass87.00877
referencechebi:15361
InChIKeyLCTONWCANYUPML-UHFFFAOYSA-M
InChIInChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/p-1
SMILESCC(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113557
reactomeM:R-ALL-113557
reactome:R-ALL-29398
reactomeM:R-ALL-29398
reactome:R-ALL-389680
reactomeM:R-ALL-389680
reactome:R-ALL-429750
reactomeM:R-ALL-429750
CHEBI:15361
chebi:15361
pyruvate
2-oxopropanoate
2-oxopropanoic acid, ion(1-)
bigg.metabolite:pyr
biggM:pyr
envipath:...cf8c962b7437
envipathM:...cf8c962b7437
Pyruvate
sabiork.compound:33
sabiorkM:33
Pyruvate
2-Ketopropionic acid
2-Oxopropanoate
2-Oxopropanoic acid
Acetylformic acid
Pyroracemic acid
Pyruvic acid
alpha-Ketopropionic acid
seed.compound:cpd00020
seedM:cpd00020
Pyruvate
2-Oxopropanoate
2-Oxopropanoic acid
2-oxo-propionic acid
2-oxopropanoate
2-oxopropanoic acid
BTS
Pyroracemic acid
Pyruvic acid
acetylformic acid
alpha-ketopropionic acid
pyr
pyroracemic acid
pyruvate
pyruvic acid
kegg.compound:C00022
keggC:C00022
Pyruvate
2-Oxopropanoate
2-Oxopropanoic acid
Pyroracemic acid
Pyruvic acid
hmdb:HMDB0000243 Pyruvic acid
2-Ketopropionate
2-Ketopropionic acid
2-Oxopropanoate
2-Oxopropanoic acid
2-Oxopropansaeure
2-Oxopropionate
2-Oxopropionic acid
2-Oxopropionsaeure
2-oxopropanoic acid
Acetylformate
Acetylformic acid
Acid, pyruvic
Acide pyruvique
BTS
Brenztraubensaeure
CH3COCOOH
Pyroracemate
Pyroracemic acid
Pyruvate
a-Ketopropionate
a-Ketopropionic acid
a-Oxopropionsaeure
alpha-Ketopropanoic acid
alpha-Ketopropionate
alpha-Ketopropionic acid
alpha-Oxopropionsaeure
alpha-ketopropanoic acid
alpha-ketopropionate
alpha-ketopropionic acid
alpha-oxopropionsaeure
pyruvic acid
lipidmaps:LMFA01060077
lipidmapsM:LMFA01060077
Pyruvic acid
2-oxo-propinoic acid
FA 3:1
O
alpha-keto propionic acid
CHEBI:177913
chebi:177913
Pyruvic-13C3 acid
2-oxo(1,2,3-13C3)propanoic acid
envipath:...009b780d3905
envipathM:...009b780d3905
compound 37937
metacyc.compound:PYRUVATE
metacycM:PYRUVATE
pyruvate
2-oxo-propionic acid
2-oxopropanoate
2-oxopropanoic acid
BTS
acetylformic acid
alpha-ketopropionic acid
pyroracemic acid
pyruvic acid
CHEBI:32816
chebi:32816
pyruvic acid
2-Oxopropanoic acid
2-Oxopropansaeure
2-Oxopropionsaeure
2-ketopropionic acid
2-oxopropanoic acid
Acetylformic acid
BTS
Brenztraubensaeure
CH3COCOOH
PYRUVIC ACID
Pyroracemic acid
Pyruvic acid
acetylformic acid
acide pyruvique
alpha-Oxopropionsaeure
alpha-ketopropionic acid
hmdb:HMDB00243
chebi:14987
chebi:26462
chebi:26466
chebi:45253
chebi:8685
biggM:M_pyr
keggC:M_C00022
seedM:M_cpd00020
secondary/obsolete/fantasy identifier