Feedback

 

pyruvate

Image of MNXM23
Properties
MNX_IDMNXM23
formulaC3H3O3
charge-1
mass87.0547
referencechebi:15361
InChIKeyLCTONWCANYUPML-UHFFFAOYSA-M
InChIInChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/p-1
SMILESCC(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of pyruvate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:14987
chebi:15361
chebi:26462
2-oxopropanoate
2-oxopropanoic acid, ion(1-)
LCTONWCANYUPML-UHFFFAOYSA-M
pyruvate
chebi:26466
chebi:32816
chebi:45253
chebi:8685
2-Oxopropanoic acid
2-Oxopropansaeure
2-Oxopropionsaeure
2-ketopropionic acid
2-oxopropanoic acid
Acetylformic acid
BTS
Brenztraubensaeure
CH3COCOOH
LCTONWCANYUPML-UHFFFAOYSA-N
PYRUVIC ACID
Pyroracemic acid
Pyruvic acid
acetylformic acid
acide pyruvique
alpha-Oxopropionsaeure
alpha-ketopropionic acid
pyruvic acid
bigg:pyr
envipath:...cf8c962b7437
Pyruvate
hmdb:HMDB00243 2-oxopropanoic acid
Pyruvic acid
pyruvic acid
kegg:C00022 2-Oxopropanoate
2-Oxopropanoic acid
Pyroracemic acid
Pyruvate
Pyruvic acid
lipidmaps:LMFA01060077 2-oxo-propionic acid
Pyruvic acid
alpha-keto propionic acid
lipidmaps:LMFA01060077
metacyc:PYRUVATE 2-oxo-propionic acid
2-oxopropanoate
2-oxopropanoic acid
BTS
PYRUVATE
acetylformic acid
alpha-ketopropionic acid
pyroracemic acid
pyruvate
pyruvic acid
reactome:1130930 PYR
phys-ent-participant10648
phys-ent-participant12391
phys-ent-participant13329
phys-ent-participant13395
phys-ent-participant13404
phys-ent-participant13618
phys-ent-participant13797
phys-ent-participant14122
phys-ent-participant33964
phys-ent-participant39646
phys-ent-participant39687
phys-ent-participant39715
phys-ent-participant57545
phys-ent-participant58895
phys-ent-participant60677
phys-ent-participant60852
phys-ent-participant60870
phys-ent-participant60962
phys-ent-participant60968
phys-ent-participant60981
phys-ent-participant75330
phys-ent-participant76084
phys-ent-participant76119
phys-ent-participant76216
phys-ent-participant82645
phys-ent-participant82977
phys-ent-participant92977
phys-ent-participant92999
phys-ent-participant93103
phys-ent-participant93709
phys-ent-participant95054
phys-ent-participant95111
phys-ent-participant96648
phys-ent-participant97026
phys-ent-participant97180
phys-ent-participant98159
phys-ent-participant9819
phys-ent-participant98755
phys-ent-participant9976
pyruvate
pyruvic acid
reactome:113557
reactome:29398
2-Oxopropanoate
2-Oxopropanoic acid
PYR
Pyroracemic acid
Pyruvate
pyruvic acid
reactome:389680 PYR
Pyruvate
pyruvic acid
reactome:5357717 pyruvic acid
sabiork:33 2-Ketopropionic acid
2-Oxopropanoate
2-Oxopropanoic acid
Acetylformic acid
Pyroracemic acid
Pyruvate
Pyruvic acid
alpha-Ketopropionic acid
seed:cpd00020 2-Oxopropanoate
2-Oxopropanoic acid
Pyroracemic acid
Pyruvate
Pyruvic acid
pyr
deprecated:MNXM162379
deprecated:MNXM89574