Feedback

(9S)-hydroperoxy-(10E,12Z,15Z)-octadecatrienoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2302Image of MNXM2302
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 3
formulaC18H29O4
charge-1
mass309.42046
referencechebi:60962
InChIKeyRWKJTIHNYSIIHW-MEBVTJQTSA-M
InChIInChI=1S/C18H30O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h3-4,6,8,11,14,17,21H,2,5,7,9-10,12-13,15-16H2,1H3,(H,19,20)/p-1/b4-3-,8-6-,14-11+/t17-/m1/s1
SMILESCC\C=C/C\C=C/C=C/[C@H](CCCCCCCC([O-])=O)OO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:60962
chebi:60962
(9S)-hydroperoxy-(10E,12Z,15Z)-octadecatrienoate
(10E,12Z,15Z)-(9S)-9-hydroperoxyoctadeca-10,12,15-trienoate
(9S,10E,12Z,15Z)-9-hydroperoxy-10,12,15-octadecatrienoate
(9S,10E,12Z,15Z)-9-hydroperoxyoctadeca-10,12,15-trienoate
(9S,10E,12Z,15Z)-9-hydroperoxyoctadeca-10,12,15-trienoic acid anion
9(S)-HPOT(1-)
9(S)-HpOTrE(1-)
CHEBI:60961
chebi:60961
(9S,10E,12Z,15Z)-9-hydroperoxyoctadeca-10,12,15-trienoic acid
(10E,12Z,15Z)-(9S)-9-hydroperoxyoctadeca-10,12,15-trienoic acid
9(S)-HPOT
9(S)-HPOTE
9(S)-HpOTrE
metacyc.compound:CPD-8678
metacycM:CPD-8678
9(S)-HPOTE
9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate
9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
seed.compound:cpd15037
seedM:cpd15037
9(S)-HPOT
(10E,12Z,15Z)-(9S)-9-Hydroperoxyoctadeca-10,12,15-trienoic acid
(9S,10E,12Z,15Z)-9-Hydroperoxy-10,12,15-octadecatrienoate
(9S,10E,12Z,15Z)-9-hydroperoxy-10,12,15-octadecadienoate
9(S)-HPOTE
9(S)-HpOTrE
9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate
9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
9-HPOT
kegg.compound:C16321
keggC:C16321
9(S)-HPOT
(10E,12Z,15Z)-(9S)-9-Hydroperoxyoctadeca-10,12,15-trienoic acid
(9S,10E,12Z,15Z)-9-Hydroperoxy-10,12,15-octadecatrienoate
9(S)-HpOTrE
lipidmaps:LMFA02000018
lipidmapsM:LMFA02000018
9S-HpOTrE
9S-hydroperoxy-10E,12Z,15Z-octadecatrienoic acid
keggC:M_C16321
seedM:M_cpd15037
secondary/obsolete/fantasy identifier