Feedback

 

(Z)-3-ureidoacrylate peracid

Image of MNXM2304
Properties
MNX_IDMNXM2304
formulaC4H6N2O4
charge0
mass146.1014
referencechebi:59889
InChIKeyAJFKXWQDHFYKFK-UPHRSURJSA-N
InChIInChI=1S/C4H6N2O4/c5-4(8)6-2-1-3(7)10-9/h1-2,9H,(H3,5,6,8)/b2-1-
SMILESNC(=O)N\C=C/C(=O)OO

This chemical compound does not exist in my selection



Occurrences of (Z)-3-ureidoacrylate peracid in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:uracp Ureidoacrylate peracid
chebi:59889 (2Z)-3-(carbamoylamino)prop-2-eneperoxoic acid
(Z)-3-ureidoacrylate peracid
AJFKXWQDHFYKFK-UPHRSURJSA-N
ureidoacrylate peracid
ureidoperacrylic acid
kegg:C20231 (Z)-3-Ureidoacrylate peracid
Ureidoperacrylic acid
metacyc:CPD0-2338 (2Z)-3-(carbamoylamino)prop-2-eneperoxoic acid
(Z)-3-ureidoacrylate peracid
CPD0-2338
peroxy ureidoacrylate
ureidoacrylate peracid
ureidoperacrylic acid
seed:cpd21464 (2Z)-3-(carbamoylamino)prop-2-eneperoxoic acid
(Z)-3-Ureidoacrylate peracid
(Z)-3-ureidoacrylate peracid
Ureidoperacrylic acid
peroxy ureidoacrylate
ureidoacrylate peracid
ureidoperacrylic acid