Feedback

(Z)-3-ureidoacrylate peracid

PropertiesImageOccurences in reactions
MNX_IDMNXM2304Image of MNXM2304
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 2
formulaC4H6N2O4
charge0
mass146.10152
referencechebi:59889
InChIKeyAJFKXWQDHFYKFK-UPHRSURJSA-N
InChIInChI=1S/C4H6N2O4/c5-4(8)6-2-1-3(7)10-9/h1-2,9H,(H3,5,6,8)/b2-1-
SMILESNC(=O)N\C=C/C(=O)OO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:59889
chebi:59889
(Z)-3-ureidoacrylate peracid
(2Z)-3-(carbamoylamino)prop-2-eneperoxoic acid
ureidoacrylate peracid
ureidoperacrylic acid
seed.compound:cpd21464
seedM:cpd21464
(Z)-3-Ureidoacrylate peracid
(2Z)-3-(carbamoylamino)prop-2-eneperoxoic acid
(Z)-3-ureidoacrylate peracid
Ureidoperacrylic acid
peroxy ureidoacrylate
ureidoacrylate peracid
ureidoperacrylic acid
kegg.compound:C20231
keggC:C20231
(Z)-3-Ureidoacrylate peracid
Ureidoperacrylic acid
metacyc.compound:CPD0-2338
metacycM:CPD0-2338
(Z)-3-ureidoacrylate peracid
(2Z)-3-(carbamoylamino)prop-2-eneperoxoic acid
peroxy ureidoacrylate
ureidoacrylate peracid
ureidoperacrylic acid
bigg.metabolite:uracp
biggM:uracp
Ureidoacrylate peracid
biggM:M_uracp
keggC:M_C20231
seedM:M_cpd21464
secondary/obsolete/fantasy identifier