Feedback

2,3-dihydroxy-p-cumate

Properties
MNX_IDMNXM2316
formulaC10H11O4
charge-1
mass195.19194
referencechebi:36647
Image of MNXM2316
InChIKeyZHDLAGPONFNQMZ-UHFFFAOYSA-M
InChIInChI=1S/C10H12O4/c1-5(2)6-3-4-7(10(13)14)9(12)8(6)11/h3-5,11-12H,1-2H3,(H,13,14)/p-1
SMILESCC(C)c1ccc(C([O-])=O)c(O)c1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref3
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:16725 2,3-dihydroxy-p-cumic acid
2,3-Dihydroxy-p-cumate
2,3-dihydroxy-4-(1-methylethyl)benzoic acid
2,3-dihydroxy-4-(propan-2-yl)benzoic acid
2,3-dihydroxy-4-isopropylbenzoic acid
4-isopropyl-o-pyrocatechuic acid
chebi:11425
chebi:19318
chebi:884
keggC:M_C06580
seedM:M_cpd03987
secondary/obsolete/fantasy identifier
chebi:36647 2,3-dihydroxy-p-cumate
2,3-dihydroxy-4-(1-methylethyl)benzoate
2,3-dihydroxy-4-(propan-2-yl)benzoate
2,3-dihydroxy-4-isopropylbenzoate
4-isopropyl-o-pyrocatechuate
envipath:...41eb07539a8f
keggC:C06580
2,3-Dihydroxy-p-cumate
seedM:cpd03987 2,3-Dihydroxy-p-cumate
2,3-dihydroxy-4-(1-methylethyl)-benzoic acid
2,3-dihydroxy-p-cumate
4-isopropyl-o-pyrocatechuic acid
metacycM:CPD-1006 2,3-dihydroxy-p-cumate
2,3-dihydroxy-4-(1-methylethyl)-benzoic acid
4-isopropyl-o-pyrocatechuic acid