Feedback

2,3-dihydroxy-p-cumate

PropertiesImageOccurences in reactions
MNX_IDMNXM2316Image of MNXM2316
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC10H11O4
charge-1
mass195.19194
referencechebi:36647
InChIKeyZHDLAGPONFNQMZ-UHFFFAOYSA-M
InChIInChI=1S/C10H12O4/c1-5(2)6-3-4-7(10(13)14)9(12)8(6)11/h3-5,11-12H,1-2H3,(H,13,14)/p-1
SMILESCC(C)c1ccc(C([O-])=O)c(O)c1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:36647
chebi:36647
2,3-dihydroxy-p-cumate
2,3-dihydroxy-4-(1-methylethyl)benzoate
2,3-dihydroxy-4-(propan-2-yl)benzoate
2,3-dihydroxy-4-isopropylbenzoate
4-isopropyl-o-pyrocatechuate
envipath:...41eb07539a8f
envipathM:...41eb07539a8f
kegg.compound:C06580
keggC:C06580
2,3-Dihydroxy-p-cumate
seed.compound:cpd03987
seedM:cpd03987
2,3-Dihydroxy-p-cumate
2,3-dihydroxy-4-(1-methylethyl)-benzoic acid
2,3-dihydroxy-p-cumate
4-isopropyl-o-pyrocatechuic acid
metacyc.compound:CPD-1006
metacycM:CPD-1006
2,3-dihydroxy-p-cumate
2,3-dihydroxy-4-(1-methylethyl)-benzoic acid
4-isopropyl-o-pyrocatechuic acid
CHEBI:16725
chebi:16725
2,3-dihydroxy-p-cumic acid
2,3-Dihydroxy-p-cumate
2,3-dihydroxy-4-(1-methylethyl)benzoic acid
2,3-dihydroxy-4-(propan-2-yl)benzoic acid
2,3-dihydroxy-4-isopropylbenzoic acid
4-isopropyl-o-pyrocatechuic acid
chebi:11425
chebi:19318
chebi:884
keggC:M_C06580
seedM:M_cpd03987
secondary/obsolete/fantasy identifier