Feedback

2-dehydro-3-deoxy-L-rhamnonate

PropertiesImageOccurences in reactions
MNX_IDMNXM2319Image of MNXM2319
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 1
formulaC6H9O5
charge-1
mass161.13266
referencechebi:58371
InChIKeyFRIWJYNKZPJVRL-IUYQGCFVSA-M
InChIInChI=1S/C6H10O5/c1-3(7)4(8)2-5(9)6(10)11/h3-4,7-8H,2H2,1H3,(H,10,11)/p-1/t3-,4+/m0/s1
SMILESC[C@H](O)[C@H](O)CC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58371
chebi:58371
2-dehydro-3-deoxy-L-rhamnonate
2-dehydro-3-deoxy-L-rhamnonate anion
2-dehydro-3-deoxy-L-rhamnonate(1-)
3,6-dideoxy-L-erythro-hex-2-ulosonate
kegg.compound:C03979
keggC:C03979
2-Dehydro-3-deoxy-L-rhamnonate
seed.compound:cpd02467
seedM:cpd02467
2-Dehydro-3-deoxy-L-rhamnonate
2-dehydro-3,6-dideoxy-L-mannonate
2-dehydro-3-deoxy-L-rhamnonate
2-dehydro-3-deoxy-L-rhamnonic acid
2-keto-3-deoxy-L-rhamnonate
KDR
Kdr
L-2-keto-3-deoxyrhamnonate
L-KDR
L-Kdr
metacyc.compound:DEHYDRO-3-DEOXY-L-RHAMNONATE
metacycM:DEHYDRO-3-DEOXY-L-RHAMNONATE
2-dehydro-3-deoxy-L-rhamnonate
2-dehydro-3,6-dideoxy-L-mannonate
2-dehydro-3-deoxy-L-rhamnonic acid
2-keto-3-deoxy-L-rhamnonate
Kdr
L-2-keto-3-deoxyrhamnonate
L-Kdr
CHEBI:18078
chebi:18078
2-dehydro-3-deoxy-L-rhamnonic acid
2-Dehydro-3-deoxy-L-rhamnonate
2-dehydro-3,6-dideoxy-L-mannonate
3,6-dideoxy-L-arabino-hex-2-ulosonic acid
chebi:1064
chebi:11558
chebi:19537
keggC:M_C03979
seedM:M_cpd02467
secondary/obsolete/fantasy identifier