Feedback

3-(hydrohydroxyphosphoryl)pyruvate

Properties
MNX_IDMNXM2328
formulaC3H3O5P
charge-2
mass150.026681
referencechebi:58348
Image of MNXM2328
InChIKeyVHAFWRWGHGSZDL-UHFFFAOYSA-L
InChIInChI=1S/C3H5O5P/c4-2(3(5)6)1-9(7)8/h9H,1H2,(H,5,6)(H,7,8)/p-2
SMILES[O-]C(=O)C(=O)CP([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:18007 3-[hydroxy(oxido)phosphoranyl]pyruvic acid
(2-carboxy-2-oxoethyl)hydroxyphosphine oxide
(Hydroxyphosphinyl)pyruvate
(hydroxyphosphinyl)pyruvic acid
3-(Hydrohydroxyphosphoryl)pyruvate
3-[hydroxy(oxido)-lambda(5)-phosphanyl]-2-oxopropanoic acid
3-[hydroxy(oxido)phosphino]-2-oxopropanoic acid
3-[hydroxy(oxido)phosphoranyl]-2-oxopropanoic acid
OHPPA
seedM:cpd03804 (Hydroxyphosphinyl)pyruvate
(hydroxyphosphinyl)pyruvate
3-(Hydrohydroxyphosphoryl)pyruvate
3-(hydrohydroxyphosphoryl)pyruvate
3-(hydroxyphosphinoyl)pyruvate
3-[hydroxy(oxido)phosphoranyl]pyruvic acid
3-hydrohydroxyphosphorylpyruvate
3hhpp
PPA
phosphinopyruvate
chebi:58348 3-(hydrohydroxyphosphoryl)pyruvate
3-(dioxidophosphoranyl)-2-oxopropanoate
3-[hydroxy(oxido)phosphoranyl]pyruvate
3-[hydroxy(oxido)phosphoranyl]pyruvate dianion
3-[hydroxy(oxido)phosphoranyl]pyruvate(2-)
keggC:C06368 3-(Hydrohydroxyphosphoryl)pyruvate
(Hydroxyphosphinyl)pyruvate
3-Phosphinopyruvate
chebi:11735
chebi:1436
chebi:19939
chebi:19940
keggC:M_C06368
seedM:M_cpd03804
secondary/obsolete/fantasy identifier
metacycM:3-HYDROHYDROXYPHOSPHORYLPYRUVATE 3-(hydroxyphosphinoyl)pyruvate
3-(hydrohydroxyphosphoryl)pyruvate
3-[hydroxy(oxido)phosphoranyl]pyruvic acid
3-hydrohydroxyphosphorylpyruvate
PPA