Feedback

3-O-methylgallate

PropertiesImageOccurences in reactions
MNX_IDMNXM2329Image of MNXM2329
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 0
formulaC8H7O5
charge-1
mass183.13818
referencechebi:19950
InChIKeyKWCCUYSXAYTNKA-UHFFFAOYSA-M
InChIInChI=1S/C8H8O5/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,9-10H,1H3,(H,11,12)/p-1
SMILESCOc1cc(cc(O)c1O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:19950
chebi:19950
3-O-methylgallate
3,4-dihydroxy-5-methoxybenzoate
4,5-Dihydroxy-m-anisate
envipath:...b41a3d23570f
envipathM:...b41a3d23570f
3-O-Methylgallate
kegg.compound:C05616
keggC:C05616
3-O-Methylgallate
3-O-Methylgallic acid
seed.compound:cpd03335
seedM:cpd03335
3-O-Methylgallate
3-O-Methylgallic acid
3-O-methylgallate
metacyc.compound:CPD-721
metacycM:CPD-721
3-O-methylgallate
CHEBI:28647
chebi:28647
3-O-methylgallic acid
3,4-dihydroxy-5-methoxybenzoic acid
3-O-Methylgallic acid
4,5-Dihydroxy-m-anisic acid
gallic acid 3-methyl ether
chebi:1615
keggC:M_C05616
seedM:M_cpd03335
secondary/obsolete/fantasy identifier