Feedback

3-O-methylgallate

Properties
MNX_IDMNXM2329
formulaC8H7O5
charge-1
mass183.13818
referencechebi:19950
Image of MNXM2329
InChIKeyKWCCUYSXAYTNKA-UHFFFAOYSA-M
InChIInChI=1S/C8H8O5/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,9-10H,1H3,(H,11,12)/p-1
SMILESCOc1cc(cc(O)c1O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref12
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
metacycM:CPD-721 3-O-methylgallate
chebi:19950 3-O-methylgallate
3,4-dihydroxy-5-methoxybenzoate
4,5-Dihydroxy-m-anisate
chebi:1615
keggC:M_C05616
seedM:M_cpd03335
secondary/obsolete/fantasy identifier
seedM:cpd03335 3-O-Methylgallate
3-O-Methylgallic acid
3-O-methylgallate
chebi:28647 3-O-methylgallic acid
3,4-dihydroxy-5-methoxybenzoic acid
3-O-Methylgallic acid
4,5-Dihydroxy-m-anisic acid
gallic acid 3-methyl ether
envipath:...b41a3d23570f 3-O-Methylgallate
keggC:C05616 3-O-Methylgallate
3-O-Methylgallic acid