Feedback

3-methylphenol

PropertiesImageOccurences in reactions
MNX_IDMNXM2330Image of MNXM2330
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 0
formulaC7H8O
charge0
mass108.05751
referencechebi:17231
InChIKeyRLSSMJSEOOYNOY-UHFFFAOYSA-N
InChIInChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3
SMILESCc1cccc(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17231
chebi:17231
3-methylphenol
1-hydroxy-3-methylbenzene
3-Cresol
3-Hydroxytoluene
M-CRESOL
m-Cresol
m-Kresol
m-cresol
m-methylphenol
meta-cresol
metacresol
sabiork.compound:5601
sabiorkM:5601
kegg.compound:C01467
keggC:C01467
3-Cresol
3-Hydroxytoluene
3-Methylphenol
m-Cresol
envipath:...1cfe0c19d746
envipathM:...1cfe0c19d746
3-Hydroxytoluene
metacyc.compound:CPD-112
metacycM:CPD-112
3-methylphenol
1-hydroxy-3-methylbenzene
3-cresol
3-hydroxytoluene
3-methyl-1-hydroxybenzene
hydroxy-3-methylbenzene
m-cresol
m-cresylic acid
m-kresol
m-methylphenol
m-oxytoluene
m-toluol
meta-cresol
meta-cresylic acid
kegg.drug:D04951
keggD:D04951
Metacresol (USP)
m-Cresol
hmdb:HMDB0002048 m-Cresol
1-Hydroxy-3-methylbenzene
3-Cresol
3-Cresol, calcium salt(1:2)
3-Cresol, sodium salt
3-Hydroxytoluene
3-Methylphenol
3-Phenylphenol
3-methylphenol
M-cresol
Meta-cresol
Metacresol
m-Cresylic acid
m-Hydroxytoluene
m-Kresol
m-Methylphenol
m-Oxytoluene
m-Toluol
seed.compound:cpd01041
seedM:cpd01041
m-Cresol
1-hydroxy-3-methylbenzene
3-Cresol
3-Hydroxytoluene
3-cresol
3-hydroxytoluene
3-methyl-1-hydroxybenzene
3-methylphenol
hydroxy-3-methylbenzene
m-cresol
m-cresylic acid
m-kresol
m-methylphenol
m-oxytoluene
m-toluol
meta-cresol
meta-cresylic acid
hmdb:HMDB02048
chebi:11771
chebi:1476
chebi:19988
chebi:41602
keggC:M_C01467
keggD:M_D04951
seedM:M_cpd01041
secondary/obsolete/fantasy identifier