|
![]() |
InChIKey | WWOBYPKUYODHDG-UHFFFAOYSA-N |
InChI | InChI=1S/C6H5ClO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H |
SMILES | Oc1ccc(Cl)cc1O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 10 |
Distinct compatimentalized reactions in models | 0 |
Identifier | Description |
---|---|
hmdb:HMDB0041810 | 4-Chlorocatechol 4-Chlorobenzene-1,2-diol 4-Chloropyrocatechol 4-chloro-1,2-Benzenediol 4-chloro-Benzene-1,2-diol 4-chloro-Pyrocatechol 4-chlorobenzene-1,2-diol 4-chlorocatechol |
chebi:27772 | 4-chlorocatechol 4-Chlorocatechol 4-chloro-1,2-benzenediol 4-chlorobenzene-1,2-diol 4-chloropyrocatechol |
seedM:cpd01586 | 4-Chlorocatechol 4-chloro-1,2-benzenediol 4-chlorobenzene-1,2-diol 4-chlorocatechol 4-chloropyrocatechol |
chebi:1806 chebi:20338 hmdb:HMDB41810 keggC:M_C02375 seedM:M_cpd01586 | secondary/obsolete/fantasy identifier |
envipath:...3ac2959728ba | compound 130 |
envipath:...dd0a972867d3 keggC:C02375 sabiorkM:6171 | 4-Chlorocatechol |
metacycM:CPD-9152 | 4-chlorocatechol 4-chloro-1,2-benzenediol 4-chlorobenzene-1,2-diol 4-chloropyrocatechol |
envipath:...0a74e6b5aa86 | compound 39342 |
MNXM723778 | is deprecated and replaced by this entry |
MNXM724085 | is deprecated and replaced by this entry |