Feedback

4-chlorocatechol

PropertiesImageOccurences in reactions
MNX_IDMNXM2332Image of MNXM2332
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 0
formulaC6H5ClO2
charge0
mass144.5554
referencechebi:27772
InChIKeyWWOBYPKUYODHDG-UHFFFAOYSA-N
InChIInChI=1S/C6H5ClO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H
SMILESOc1ccc(Cl)cc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:27772
chebi:27772
4-chlorocatechol
4-Chlorocatechol
4-chloro-1,2-benzenediol
4-chlorobenzene-1,2-diol
4-chloropyrocatechol
sabiork.compound:6171
sabiorkM:6171
envipath:...dd0a972867d3
envipathM:...dd0a972867d3
kegg.compound:C02375
keggC:C02375
4-Chlorocatechol
hmdb:HMDB0041810 4-Chlorocatechol
4-Chlorobenzene-1,2-diol
4-Chloropyrocatechol
4-chloro-1,2-Benzenediol
4-chloro-Benzene-1,2-diol
4-chloro-Pyrocatechol
4-chlorobenzene-1,2-diol
4-chlorocatechol
seed.compound:cpd01586
seedM:cpd01586
4-Chlorocatechol
4-chloro-1,2-benzenediol
4-chlorobenzene-1,2-diol
4-chlorocatechol
4-chloropyrocatechol
metacyc.compound:CPD-9152
metacycM:CPD-9152
4-chlorocatechol
4-chloro-1,2-benzenediol
4-chlorobenzene-1,2-diol
4-chloropyrocatechol
envipath:...3ac2959728ba
envipathM:...3ac2959728ba
compound 130
envipath:...0a74e6b5aa86
envipathM:...0a74e6b5aa86
compound 39342
hmdb:HMDB41810
chebi:1806
chebi:20338
keggC:M_C02375
seedM:M_cpd01586
secondary/obsolete/fantasy identifier