Feedback

5-deoxy-D-glucuronate

Properties
MNX_IDMNXM2337
formulaC6H9O6
charge-1
mass177.13206
referencechebi:58852
Image of MNXM2337
InChIKeyHPITTXOWHLWIEK-IWGUZYHVSA-M
InChIInChI=1S/C6H10O6/c7-2-4(9)6(12)3(8)1-5(10)11/h2-4,6,8-9,12H,1H2,(H,10,11)/p-1/t3-,4+,6+/m1/s1
SMILESO[C@H](CC([O-])=O)[C@H](O)[C@@H](O)C=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
chebi:58852 5-deoxy-D-glucuronate
(3R,4S,5R)-3,4,5-trihydroxy-6-oxohexanoate
5-deoxy-D-xylo-hexuronate
keggC:M_C16737
seedM:M_cpd16540
secondary/obsolete/fantasy identifier
chebi:50923 5-deoxy-D-glucuronic acid
5-Deoxy glucuronic acid
5-deoxy-D-xylo-hexuronic acid
seedM:cpd16540 5-Deoxy glucuronic acid
5-Deoxy-D-glucuronate
5-Deoxy-D-xylo-hexuronic acid
5-deoxy-D-glucuronate
metacycM:CPD-15127 5-deoxy-D-glucuronate
keggC:C16737 5-Deoxy-D-glucuronate
5-Deoxy-D-glucuronic acid
5-Deoxy-D-xylo-hexuronic acid