Feedback

6-aminohexanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2339Image of MNXM2339
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 3
formulaC6H13NO2
charge0
mass131.17296
referencechebi:57826
InChIKeySLXKOJJOQWFEFD-UHFFFAOYSA-N
InChIInChI=1S/C6H13NO2/c7-5-3-1-2-4-6(8)9/h1-5,7H2,(H,8,9)
SMILES[NH3+]CCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57826
chebi:57826
6-aminohexanoate
6-aminohexanoic acid zwitterion
6-ammoniohexanoate
6-azaniumylhexanoate
bigg.metabolite:6ax
biggM:6ax
envipath:...9b84ec5de751
envipathM:...9b84ec5de751
6-Aminohexanoate
kegg.compound:C02378
keggC:C02378
6-Aminohexanoate
6-Aminocaproic acid
6-Aminohexanoic acid
Epsilcapramine
lipidmaps:LMFA01100035
lipidmapsM:LMFA01100035
6-amino-hexanoic acid
6-Aminohexanoic acid
6-amino-hexanoic acid
CHEBI:32396
chebi:32396
6-aminohexanoate
6-Aminohexanoate
6-amino-n-caproate
metacyc.compound:CPD-884
metacycM:CPD-884
6-aminohexanoate
6-amino-n-caproate
6-amino-n-caproic acid
6-amino-n-hexanoic acid
6-aminocaproic acid
6-aminocapronate
6-aminohexanoic acid
acepramin
acepramine
amicar
aminocaproic acid
aminokapron
atsemin
caplamin
capracid
capralense
capramol
caprolisin
e-amino-n-caproic acid
epsilcapramine
epsilon-amino-N-caproate
epsilon-aminocaproate
epsilon-aminocaproic acid
hexanoic acid, 6-amino-
CHEBI:16586
chebi:16586
6-aminohexanoic acid
6-AMINOHEXANOIC ACID
6-Aminocaproic acid
6-Aminohexanoic acid
AMINOCAPROIC
Ahx
Amicar
Amikar
Capralense
Capramol
Caproamin
Caprocid
Caprolisin
EACA
Epsamon
Epsicaprom
Epsicapron
Epsikapron
Epsilcapramin
Epsilcapramine
Epsilon S
Respramin
Z
acide aminocaproque
acido aminocaproico
acidum aminocaproicum
aminocaproic acid
aminohexanoic acid
epsilon-Ahx
epsilon-amino-n-hexanoic acid
epsilon-aminocaproic acid
epsilon-aminohexanoic acid
epsilon-leucine
epsilon-norleucine
omega-aminocaproic acid
omega-aminohexanoic acid
kegg.drug:D00160
keggD:D00160
Aminocaproic acid (USP/INN)
Amicar (TN)
Epsilon-Aminocaproic acid (JAN)
hmdb:HMDB0001901 Aminocaproic acid
6 Aminocaproic acid
6 Aminohexanoic acid
6-Aminocaproate
6-Aminocaproic acid
6-Aminohexanoate
6-Aminohexanoic acid
6-amino-Hexanoate
6-amino-Hexanoic acid
6-amino-N-Hexanoate
6-amino-N-Hexanoic acid
6-aminohexanoic acid
AMINOCAPROIC
Acepramin
Acepramine
Acide aminocaproque
Acidum aminocaproicum
Acikaprin
Afibrin
Ahx
Amicar
Amikar
Aminocaproate
Aminohexanoate
Aminohexanoic acid
Aminokapron
Atsemin
Caplamin
Capracid
Capralense
Capramol
Capranol
Caproamin
Caprocid
Caprolest
Caprolisin
Delagrange brand OF aminocaproic acid
EACA
Epsamon
Epsicaprom
Epsicapron
Epsikapron
Epsilcapramin
Epsilcapramine
Epsillon-aminocaproate
Epsillon-aminocaproic acid
Epsillon-aminocaproic acid' epsilcapramin
Epsilon S
H-6-Ahx-OH
H-EAhx-OH
H-epsilon-Acp-OH
Hemocaprol
Hemopar
Hepin
Hexalense
Ipsilon
Leurquin brand OF aminocaproic acid
Omega-aminocaproate
Omega-aminocaproic acid
Omega-aminohexanoate
Omega-aminohexanoic acid
Pharmachemie brand OF aminocaproic acid
Respramin
Rottapharm brand OF aminocaproic acid
Sanofi winthrop brand OF aminocaproic acid
W-Aminocaproate
W-Aminocaproic acid
W-Aminohexanoate
W-Aminohexanoic acid
Z
acido Aminocaproico
aminocaproic acid
e-Aminocaproate
e-Aminocaproic acid
e-Aminocaproic acid usp
e-Aminohexanoate
e-Aminohexanoic acid
e-Leucine
e-Norleucine
e-amino-N-Hexanoate
e-amino-N-Hexanoic acid
epsilon Aminocaproic acid
epsilon-Ahx
epsilon-Aminocaproate
epsilon-Aminocaproic acid
epsilon-Aminocaproic acid usp
epsilon-Aminohexanoate
epsilon-Aminohexanoic acid
epsilon-Leucine
epsilon-Norleucine
epsilon-S
epsilon-amino-N-Hexanoate
epsilon-amino-N-Hexanoic acid
seed.compound:cpd01588
seedM:cpd01588
Epsilcapramine
6-Aminocaproic acid
6-Aminohexanoate
6-Aminohexanoic acid
6-amino-n-caproate
6-amino-n-caproic acid
6-amino-n-hexanoic acid
6-aminocaproic acid
6-aminocapronate
6-aminohexanoate
6-aminohexanoic acid
6ax
acepramin
acepramine
amicar
aminocaproic acid
aminokapron
atsemin
caplamin
capracid
capralense
capramol
caprolisin
e-amino-n-caproic acid
epsilcapramine
epsilon-amino-N-caproate
epsilon-aminocaproate
epsilon-aminocaproic acid
hexanoic acid, 6-amino-
hmdb:HMDB0002002
hmdb:HMDB01901
hmdb:HMDB02002
chebi:12206
chebi:20703
chebi:2171
chebi:227755
chebi:40458
biggM:M_6ax
keggC:M_C02378
keggD:M_D00160
seedM:M_cpd01588
secondary/obsolete/fantasy identifier