Feedback

6-aminohexanoate

Properties
MNX_IDMNXM2339
formulaC6H13NO2
charge0
mass131.17296
referencechebi:57826
Image of MNXM2339
InChIKeySLXKOJJOQWFEFD-UHFFFAOYSA-N
InChIInChI=1S/C6H13NO2/c7-5-3-1-2-4-6(8)9/h1-5,7H2,(H,8,9)
SMILES[NH3+]CCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
chebi:32396 6-aminohexanoate
6-Aminohexanoate
6-amino-n-caproate
metacycM:CPD-884 6-aminohexanoate
6-amino-n-caproate
6-amino-n-caproic acid
6-amino-n-hexanoic acid
6-aminocaproic acid
6-aminocapronate
6-aminohexanoic acid
acepramin
acepramine
amicar
aminocaproic acid
aminokapron
atsemin
caplamin
capracid
capralense
capramol
caprolisin
e-amino-n-caproic acid
epsilcapramine
epsilon-amino-N-caproate
epsilon-aminocaproate
epsilon-aminocaproic acid
hexanoic acid, 6-amino-
keggD:D00160 Aminocaproic acid (USP/INN)
Amicar (TN)
Epsilon-Aminocaproic acid (JAN)
chebi:16586 6-aminohexanoic acid
6-AMINOHEXANOIC ACID
6-Aminocaproic acid
6-Aminohexanoic acid
AMINOCAPROIC
Ahx
Amicar
Amikar
Capralense
Capramol
Caproamin
Caprocid
Caprolisin
EACA
Epsamon
Epsicaprom
Epsicapron
Epsikapron
Epsilcapramin
Epsilcapramine
Epsilon S
Respramin
Z
acide aminocaproque
acido aminocaproico
acidum aminocaproicum
aminocaproic acid
aminohexanoic acid
epsilon-Ahx
epsilon-amino-n-hexanoic acid
epsilon-aminocaproic acid
epsilon-aminohexanoic acid
epsilon-leucine
epsilon-norleucine
omega-aminocaproic acid
omega-aminohexanoic acid
keggC:C02378 6-Aminohexanoate
6-Aminocaproic acid
6-Aminohexanoic acid
Epsilcapramine
seedM:cpd01588 Epsilcapramine
6-Aminocaproic acid
6-Aminohexanoate
6-Aminohexanoic acid
6-amino-n-caproate
6-amino-n-caproic acid
6-amino-n-hexanoic acid
6-aminocaproic acid
6-aminocapronate
6-aminohexanoate
6-aminohexanoic acid
6ax
acepramin
acepramine
amicar
aminocaproic acid
aminokapron
atsemin
caplamin
capracid
capralense
capramol
caprolisin
e-amino-n-caproic acid
epsilcapramine
epsilon-amino-N-caproate
epsilon-aminocaproate
epsilon-aminocaproic acid
hexanoic acid, 6-amino-
lipidmaps:LMFA01100035 6-amino-hexanoic acid
6-Aminohexanoic acid
6-amino-hexanoic acid
biggM:M_6ax
chebi:12206
chebi:20703
chebi:2171
chebi:227755
chebi:40458
hmdb:HMDB0002002
hmdb:HMDB01901
hmdb:HMDB02002
keggC:M_C02378
keggD:M_D00160
seedM:M_cpd01588
secondary/obsolete/fantasy identifier
biggM:6ax
envipath:...9b84ec5de751
6-Aminohexanoate
chebi:57826 6-aminohexanoate
6-aminohexanoic acid zwitterion
6-ammoniohexanoate
6-azaniumylhexanoate
hmdb:HMDB0001901 Aminocaproic acid
6 Aminocaproic acid
6 Aminohexanoic acid
6-Aminocaproate
6-Aminocaproic acid
6-Aminohexanoate
6-Aminohexanoic acid
6-amino-Hexanoate
6-amino-Hexanoic acid
6-amino-N-Hexanoate
6-amino-N-Hexanoic acid
6-aminohexanoic acid
AMINOCAPROIC
Acepramin
Acepramine
Acide aminocaproque
Acidum aminocaproicum
Acikaprin
Afibrin
Ahx
Amicar
Amikar
Aminocaproate
Aminohexanoate
Aminohexanoic acid
Aminokapron
Atsemin
Caplamin
Capracid
Capralense
Capramol
Capranol
Caproamin
Caprocid
Caprolest
Caprolisin
Delagrange brand OF aminocaproic acid
EACA
Epsamon
Epsicaprom
Epsicapron
Epsikapron
Epsilcapramin
Epsilcapramine
Epsillon-aminocaproate
Epsillon-aminocaproic acid
Epsillon-aminocaproic acid' epsilcapramin
Epsilon S
H-6-Ahx-OH
H-EAhx-OH
H-epsilon-Acp-OH
Hemocaprol
Hemopar
Hepin
Hexalense
Ipsilon
Leurquin brand OF aminocaproic acid
Omega-aminocaproate
Omega-aminocaproic acid
Omega-aminohexanoate
Omega-aminohexanoic acid
Pharmachemie brand OF aminocaproic acid
Respramin
Rottapharm brand OF aminocaproic acid
Sanofi winthrop brand OF aminocaproic acid
W-Aminocaproate
W-Aminocaproic acid
W-Aminohexanoate
W-Aminohexanoic acid
Z
acido Aminocaproico
aminocaproic acid
e-Aminocaproate
e-Aminocaproic acid
e-Aminocaproic acid usp
e-Aminohexanoate
e-Aminohexanoic acid
e-Leucine
e-Norleucine
e-amino-N-Hexanoate
e-amino-N-Hexanoic acid
epsilon Aminocaproic acid
epsilon-Ahx
epsilon-Aminocaproate
epsilon-Aminocaproic acid
epsilon-Aminocaproic acid usp
epsilon-Aminohexanoate
epsilon-Aminohexanoic acid
epsilon-Leucine
epsilon-Norleucine
epsilon-S
epsilon-amino-N-Hexanoate
epsilon-amino-N-Hexanoic acid