Feedback

dUMP

PropertiesImageOccurences in reactions
MNX_IDMNXM234Image of MNXM234
#reac
in my sandbox 0
in MNXref (generic)25
in models (compartimentalized) 24
formulaC9H11N2O8P
charge-2
mass306.166081
referencechebi:246422
InChIKeyJSRLJPSBLDHEIO-SHYZEUOFSA-L
InChIInChI=1S/C9H13N2O8P/c12-5-3-8(11-2-1-7(13)10-9(11)14)19-6(5)4-18-20(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,10,13,14)(H2,15,16,17)/p-2/t5-,6+,8+/m0/s1
SMILESO[C@H]1C[C@@H](O[C@@H]1COP([O-])([O-])=O)n1ccc(=O)[nH]c1=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:246422
chebi:246422
dUMP
2'-deoxy-5'-O-phosphonatouridine
dUMP dianion
dUMP(2-)
deoxyuridine 5'-phosphate dianion
deoxyuridine 5'-phosphate(2-)
deoxyuridylate
bigg.metabolite:dump
biggM:dump
DUMP
hmdb:HMDB0001409 dUMP
2'-Deoxy-5'-uridylate
2'-Deoxy-5'-uridylic acid
2'-Deoxyuridine 5'-monophosphate
2'-Deoxyuridine 5'-monophosphoric acid
2'-Deoxyuridine 5'-phosphate
2'-Deoxyuridine 5'-phosphoric acid
2'-Deoxyuridine-5'-monophosphate
2'-Deoxyuridylate
2'-Deoxyuridylic acid
2'-Deoxyuridylic acid, disodium salt
2'-deoxyuridylic acid
Deoxy-UMP
Deoxyuridine 5'-monophosphate
Deoxyuridine 5'-phosphate
Deoxyuridine 5'-phosphoric acid
Deoxyuridine monophosphate
Deoxyuridine monophosphoric acid
Deoxyuridylate
Deoxyuridylic acid
{[(2R,3S,5R)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy}phosphonic acid
reactome:R-ALL-109382
reactomeM:R-ALL-109382
reactome:R-ALL-109510
reactomeM:R-ALL-109510
reactome:R-ALL-500742
reactomeM:R-ALL-500742
CHEBI:17622
chebi:17622
dUMP
2'-Deoxyuridine 5'-phosphate
2'-deoxy-5'-uridylic acid
2'-deoxyuridine 5'-monophosphate
Deoxyuridine 5'-phosphate
Deoxyuridine monophosphate
Deoxyuridylic acid
deoxyuridylate
seed.compound:cpd00299
seedM:cpd00299
dUMP
2'-Deoxyuridine 5'-phosphate
2'-deoxy-5'-uridylic acid
2'-deoxyuridine 5'-phosphate
2'-deoxyuridine 5-monophosphate
2'-deoxyuridine-5'-phosphate
2'-deoxyuridine-5-monophosphate
2'-deoxyuridylic acid
Deoxyuridine 5'-phosphate
Deoxyuridine monophosphate
Deoxyuridylic acid
deoxyurdine-phosphate
deoxyuridine-phosphate
dump
sabiork.compound:1334
sabiorkM:1334
kegg.compound:C00365
keggC:C00365
dUMP
2'-Deoxyuridine 5'-phosphate
Deoxyuridine 5'-phosphate
Deoxyuridine monophosphate
Deoxyuridylic acid
metacyc.compound:DUMP
metacycM:DUMP
dUMP
2'-deoxy-5'-uridylic acid
2'-deoxyuridine 5'-phosphate
2'-deoxyuridine 5-monophosphate
2'-deoxyuridylic acid
deoxyurdine-phosphate
deoxyuridine-phosphate
hmdb:HMDB01409
chebi:10532
chebi:14094
chebi:19263
chebi:42245
chebi:46286
chebi:46288
chebi:47722
biggM:M_dump
keggC:M_C00365
seedM:M_cpd00299
secondary/obsolete/fantasy identifier