|
|
|||||||||||||
| InChIKey | KDCGOANMDULRCW-UHFFFAOYSA-N |
| InChI | InChI=1S/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H,(H,6,7,8,9) |
| SMILES | c1nc2ncncc2[nH]1 |
| #reac | |
|---|---|
| Distinct reactions in my sandbox | 0 |
| Distinct generic reactions in MNXref | 17 |
| Distinct compatimentalized reactions in models | 1 |
| Identifier | Description |
|---|---|
| keggC:C15587 | Purine Purine base |
| chebi:35589 | 9H-purine |
| hmdb:HMDB0001366 | Purine 1H-Purine 6H-imidazo[4,5-D]Pyrimidine 7-Methyltheophylline 7H-Purine 7H-imidazo(4,5-D)Pyrimidine 7H-purine 9H-Purine Caffedrine Caffein Cafipel Coffeine Dasin Dexitac Diurex Durvitan Isopurine Koffein Mateina Methyltheobromine Phensal Propoxyphene compound 65 Purine base beta-Purine imidazo(4,5-D)Pyrimidine purine {6h-imidazo[4,5-D]pyrimidine} {7h-imidazo[4,} 5-D]pyrimidine {Imidazo[4,5-D]pyrimidine} |
| biggM:M_purine chebi:14968 chebi:8639 hmdb:HMDB01366 keggC:M_C15587 seedM:M_cpd00360 seedM:M_cpd27823 | secondary/obsolete/fantasy identifier |
| seedM:cpd00360 | Purine Purine base purine |
| chebi:35584 metacycM:PURINE | purine |
| chebi:17258 | 7H-purine Purine Purine base |
| chebi:35586 | 1H-purine |
| chebi:35588 | 3H-purine |
| biggM:purine sabiorkM:2053 | Purine |
| metacycM:PURINE-RING seedM:cpd27823 | purine-ring |
| MNXM725349 | is deprecated and replaced by this entry |
| MNXM79767 | is deprecated and replaced by this entry |
