Feedback

orotate

PropertiesImageOccurences in reactions
MNX_IDMNXM235Image of MNXM235
#reac
in my sandbox 0
in MNXref (generic)62
in models (compartimentalized) 24
formulaC5H3N2O4
charge-1
mass155.0884
referencechebi:30839
InChIKeyPXQPEWDEAKTCGB-UHFFFAOYSA-M
InChIInChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11)/p-1
SMILES[O-]C(=O)c1cc(=O)[nH]c(=O)[nH]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30839
chebi:30839
orotate
2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate
bigg.metabolite:orot
biggM:orot
Orotate
sabiork.compound:2009
sabiorkM:2009
kegg.compound:C00295
keggC:C00295
Orotate
Orotic acid
Uracil-6-carboxylic acid
seed.compound:cpd00247
seedM:cpd00247
Orotate
Orotic acid
Uracil-6-carboxylic acid
orot
orotate
orotic acid
kegg.drug:D00055
keggD:D00055
Orotic acid (JAN)
hmdb:HMDB0000226 Orotic acid
1,2,3,6-tetrahydro-2,6-Dioxopyrimidin-4-carbonsaeure
1,2,3,6-tetrahydro-2,6-dioxo-4-Pyrimidecarboxylic acid
1,2,3,6-tetrahydro-2,6-dioxo-4-Pyrimidinecarboxylic acid
2,6-Dihydroxy-4-pyrimidinecarboxylic acid
2,6-Dihydroxypyrimidine-4-carboxylic acid
2,6-dioxo-1,2,3,6-Tetrahydropyrimidine-4-carboxylic acid
2,6-dioxo-1,2,3,6-tetrahydro-Pyrimidine-4-carboxylic acid
2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid
6-Carboxy-2,4-dihydroxypyrimidine
6-Carboxyuracil
6-Uracilcarboxylic acid
Acid, orotic
Acide orotique
Acidum oroticum
Animal galactose factor
Lactinium
Molkensaeure
ORO
Orodin
Oropur
Orotate
Orotate, potassium
Orotate, sodium
Orotate, zinc
Orotonin
Orotonsan
Orotsaeure
Orotsaure
Oroturic
Orotyl
Potassium orotate
Sodium orotate
Uracil-6-carbosaeure
Uracil-6-carboxylate
Uracil-6-carboxylic acid
Vitamin b13
Whey factor
Zinc orotate
acido Orotico
orotic acid
metacyc.compound:OROTATE
metacycM:OROTATE
orotate
orotic acid
reactome:R-ALL-76632
reactomeM:R-ALL-76632
CHEBI:16742
chebi:16742
orotic acid
2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid
OROTIC ACID
Orotic acid
Orotsaeure
Uracil-6-carboxylic acid
hmdb:HMDB00226
chebi:14698
chebi:25719
chebi:25720
chebi:44781
chebi:7787
biggM:M_orot
keggC:M_C00295
keggD:M_D00055
seedM:M_cpd00247
secondary/obsolete/fantasy identifier