Feedback

clavaminate

Properties
MNX_IDMNXM2359
formulaC8H10N2O4
charge0
mass198.17608
referencechebi:57300
Image of MNXM2359
InChIKeyGQHALSXZONOXGJ-WHJCQOFKSA-N
InChIInChI=1S/C8H10N2O4/c9-2-1-4-7(8(12)13)10-5(11)3-6(10)14-4/h1,6-7H,2-3,9H2,(H,12,13)/b4-1-/t6-,7-/m0/s1
SMILES[NH3+]C\C=C1/O[C@H]2CC(=O)N2[C@@H]1C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:57300 clavaminate
(2S,3Z,5S)-3-(2-azaniumylethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate
clavaminic acid zwitterion
chebi:15423 clavaminic acid
(2S,3Z,5S)-3-(2-aminoethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
Clavaminate
Clavaminic acid
chebi:14003
chebi:3733
keggC:M_C06660
seedM:M_cpd04063
secondary/obsolete/fantasy identifier
keggC:C06660 Clavaminic acid
Clavaminate
seedM:cpd04063 Clavaminate
(3S,5S)-clavaminic acid
Clavaminic acid
clavaminate
clavaminic acid
metacycM:CLAVAMINATE clavaminate
(3S,5S)-clavaminic acid
clavaminic acid