Feedback

octadecanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM236Image of MNXM236
#reac
in my sandbox 0
in MNXref (generic)204
in models (compartimentalized) 108
formulaC18H35O2
charge-1
mass283.4693
referencechebi:25629
InChIKeyQIQXTHQIDYTFRH-UHFFFAOYSA-M
InChIInChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/p-1
SMILESCCCCCCCCCCCCCCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:25629
chebi:25629
octadecanoate
CH3-[CH2]16-COO(-)
Stearate
octadecanoic acid, ion(1-)
stearate
stearic acid, ion(1-)
bigg.metabolite:ocdca
biggM:ocdca
Octadecanoate (n-C18:0)
kegg.compound:C01530
keggC:C01530
Octadecanoic acid
Stearate
Stearic acid
sabiork.compound:20032
sabiorkM:20032
Stearate
Octadecanoic acid
Stearic acid
kegg.drug:D00119
keggD:D00119
Stearic acid (JP17/NF)
Stearic acid (TN)
hmdb:HMDB0000827 Stearic acid
1-Heptadecanecarboxylate
1-Heptadecanecarboxylic acid
18:0
Acide octadecanoique
Acide stearique
Aluminum monostearate
Aluminum tristearate
Ammonium stearate
C18:0
CH3-[CH2]16-COOH
Calcium stearate
Magnesium stearate
N-Octadecanoate
N-Octadecanoic acid
Octadecanoate
Octadecanoic acid
Octadecansaeure
Octadecoate
Octadecoic acid
Oktadekansaeure
Sodium stearate
Stearate
Stearex beads
Stearic acid cherry
Stearinsaeure
Stearophanate
Stearophanic acid
Zinc stearate
octadecanoic acid
stearic acid
lipidmaps:LMFA01010018
lipidmapsM:LMFA01010018
Stearic acid
Bassinic acid
C18:0
Cetylacetic acid
FA(18:0)
Lactaric acid
Octadecanoate
Stearate
Stearophanic acid
Talgic acid
n-Octadecanoic acid
octadecanoic acid
seed.compound:cpd01080
seedM:cpd01080
ocdca
Octadecanoic acid
Stearate
Stearic acid
octadecanoate
octadecanoate (n-C18:0)
octadecanoic acid
stearate
stearic acid
SLM:000000826
slm:000000826
octadecanoate
Stearate
CHEBI:28842
chebi:28842
octadecanoic acid
18:0
C18:0
CH3-[CH2]16-COOH
Octadecanoic acid
Octadecansaeure
Oktadekansaeure
STEARIC ACID
Stearinsaeure
acide octadecanoique
acide stearique
n-octadecanoic acid
octadecoic acid
stearic acid
envipath:...96b6726ed216
envipathM:...96b6726ed216
peak 4 (Neudosan)
peak 1-6 (Neudosan)
metacyc.compound:STEARIC_ACID
metacycM:STEARIC_ACID
stearate
octadecanoate (n-C18:0)
octadecanoic acid
stearic acid
hmdb:HMDB00827
chebi:231588
chebi:25631
chebi:45710
biggM:M_ocdca
keggC:M_C01530
keggD:M_D00119
seedM:M_cpd01080
secondary/obsolete/fantasy identifier