Feedback

cyclohexane-1,3-dione

PropertiesImageOccurences in reactions
MNX_IDMNXM2364Image of MNXM2364
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC6H8O2
charge0
mass112.05243
referencechebi:17766
InChIKeyHJSLFCCWAKVHIW-UHFFFAOYSA-N
InChIInChI=1S/C6H8O2/c7-5-2-1-3-6(8)4-5/h1-4H2
SMILESO=C1CCCC(=O)C1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17766
chebi:17766
cyclohexane-1,3-dione
1,3-Cyclohexanedione
Cyclohexane-1,3-dione
Dihydroresorcinol
kegg.compound:C01066
keggC:C01066
Cyclohexane-1,3-dione
1,3-Cyclohexanedione
Dihydroresorcinol
seed.compound:cpd00784
seedM:cpd00784
Dihydroresorcinol
1,3-Cyclohexanedione
Cyclohexane-1,3-dione
cyclohexane-1,3-dione
envipath:...4a749d34f323
envipathM:...4a749d34f323
compound 40193
envipath:...6253561938ac
envipathM:...6253561938ac
compound 40196
metacyc.compound:CYCLOHEXANE-13-DIONE
metacycM:CYCLOHEXANE-13-DIONE
cyclohexane-1,3-dione
chebi:14050
chebi:23473
chebi:4010
keggC:M_C01066
seedM:M_cpd00784
secondary/obsolete/fantasy identifier