Feedback

D-phenylalanine

PropertiesImageOccurences in reactions
MNX_IDMNXM2365Image of MNXM2365
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 0
formulaC9H11NO2
charge0
mass165.18918
referencechebi:57981
InChIKeyCOLNVLDHVKWLRT-MRVPVSSYSA-N
InChIInChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1
SMILES[NH3+][C@H](Cc1ccccc1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57981
chebi:57981
D-phenylalanine
(2R)-2-ammonio-3-phenylpropanoate
(2R)-2-azaniumyl-3-phenylpropanoate
D-phenylalanine zwitterion
sabiork.compound:2396
sabiorkM:2396
kegg.compound:C02265
keggC:C02265
D-Phenylalanine
D-alpha-Amino-beta-phenylpropionic acid
seed.compound:cpd01526
seedM:cpd01526
D-Phenylalanine
D-alpha-Amino-beta-phenylpropionic acid
D-alpha-amino-beta-phenylpropionic acid
D-phenylalanine
CHEBI:32494
chebi:32494
D-phenylalaninate
(2R)-2-amino-3-phenylpropanoate
D-phenylalanine anion
CHEBI:16998
chebi:16998
D-phenylalanine
(2R)-2-amino-3-phenylpropanoic acid
D-PHENYLALANINE
D-Phe
D-Phenylalanine
D-alpha-Amino-beta-phenylpropionic acid
DPN
phenylalanine D-form
metacyc.compound:CPD-216
metacycM:CPD-216
D-phenylalanine
D-alpha-amino-beta-phenylpropionic acid
CHEBI:32495
chebi:32495
D-phenylalaninium
(1R)-1-carboxy-2-phenylethanaminium
D-phenylalanine cation
chebi:13007
chebi:21067
chebi:42207
chebi:4224
keggC:M_C02265
seedM:M_cpd01526
secondary/obsolete/fantasy identifier