This is version 4.2 of MetaNetX/MNXref
 Feedback

(6S)-10-formyltetrahydrofolate

MNXM237 is deprecated and here replaced by MNXM1102376
!!! Alternative mappings exist !!!
PropertiesImageOccurences in reactions
MNX_IDMNXM1102376Image of MNXM1102376
#reac
in my sandbox 0
in MNXref (generic)51
in models (compartimentalized) 92
formulaC20H21N7O7
charge-2
mass471.42372
referencechebi:57454
InChIKeyAUFGTPPARQZWDO-YPMHNXCESA-L
InChIInChI=1S/C20H23N7O7/c21-20-25-16-15(18(32)26-20)23-11(7-22-16)8-27(9-28)12-3-1-10(2-4-12)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,9,11,13,23H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,22,25,26,32)/p-2/t11-,13+/m1/s1
SMILESNc1nc2NC[C@H](CN(C=O)c3ccc(cc3)C(=O)N[C@@H](CCC([O-])=O)C([O-])=O)Nc2c(=O)[nH]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57454
chebi:57454
(6S)-10-formyltetrahydrofolate
10-formyltetrahydrofolate dianion
10-formyltetrahydrofolate(2-)
N-[4-(N-{[(6S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}formamido)benzoyl]-L-glutamate
bigg.metabolite:10fthf
biggM:10fthf
10-Formyltetrahydrofolate
hmdb:HMDB0000972 10-Formyltetrahydrofolate
(2S)-2-[(4-{N-[(2-amino-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl)methyl]formamido}phenyl)formamido]pentanedioic acid
(2S)-2-[(4-{N-[(2-amino-4-oxo-5,6,7,8-tetrahydro-1H-pteridin-6-yl)methyl]formamido}phenyl)formamido]pentanedioic acid
10-FTHF
10-Formyl-(6Rs)-tetrahydrofolic acid
10-Formyl-H4pteglu1
10-Formyl-THF
10-Formyl-tetrahydrofolate
10-Formyltetrahydrofolic acid
10-Formyltetrahydropteroylglutamate
10-Formyltetrahydropteroylglutamic acid
N-[P-[N-[(2-amino-5,6,7,8-tetrahydro-4-Hydroxy-6-pteridinyl)methyl]formamido]benzoyl]-L-glutamate
N-[P-[N-[(2-amino-5,6,7,8-tetrahydro-4-Hydroxy-6-pteridinyl)methyl]formamido]benzoyl]-L-glutamic acid
N-[P-[N-[(2-amino-5,6,7,8-tetrahydro-4-Hydroxy-6-pteridinyl)methyl]formamido]benzoyl]-glutamate
N-[P-[N-[(2-amino-5,6,7,8-tetrahydro-4-Hydroxy-6-pteridinyl)methyl]formamido]benzoyl]-glutamic acid
N10-Formyl-5,6,7,8-tetrahydrofolate
N10-Formyl-5,6,7,8-tetrahydrofolic acid
N10-Formyl-H4F
N10-Formyl-THF
N10-Formyltetrahydrofolate
N10-Formyltetrahydrofolic acid
N10-Formyltetrahydropteroylglutamate
kegg.compound:C00234
keggC:C00234
10-Formyltetrahydrofolate
10-Formyl-THF
seed.compound:cpd00201
seedM:cpd00201
10-Formyltetrahydrofolate
10-Formyl-THF
10-formyl-H4PteGlu1
10-formyl-THF
10-formyl-THF mono-L-glutamate
10-formyl-tetrahydrofolate
10-formyl-tetrahydrofolate mono-L-glutamate
10fthf
N10-formyl-H4F
N10-formyl-H4F mono-L-glutamate
N10-formyl-H4PteGlu1
N10-formyl-THF
N10-formyl-THF mono-L-glutamate
N10-formyl-tetrahydrofolate
N10-formyl-tetrahydrofolate mono-L-glutamate
metacyc.compound:10-FORMYL-THF
metacycM:10-FORMYL-THF
10-formyl-tetrahydrofolate mono-L-glutamate
10-formyl-H4PteGlu1
10-formyl-THF mono-L-glutamate
N10-formyl-H4F mono-L-glutamate
N10-formyl-H4PteGlu1
N10-formyl-THF mono-L-glutamate
N10-formyl-tetrahydrofolate mono-L-glutamate
reactome:R-ALL-419151
reactomeM:R-ALL-419151
reactome:R-ALL-5389850
reactomeM:R-ALL-5389850
CHEBI:15637
chebi:15637
10-formyltetrahydrofolic acid
(6S)-10-HCO-H4folate
10-FTHF
10-Formyl-THF
10-Formyltetrahydrofolate
10-formyltetrahydropteroylglutamic acid
N-(10-formyl-5,6,7,8-tetrahydropteroyl)-L-glutamic acid
N-[4-(N-{[(6S)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}formamido)benzoyl]-L-glutamic acid
hmdb:HMDB00972
chebi:11304
chebi:19108
chebi:19109
chebi:698
biggM:M_10fthf
keggC:M_C00234
seedM:M_cpd00201
secondary/obsolete/fantasy identifier