Feedback

mugineate

PropertiesImageOccurences in reactions
MNX_IDMNXM2400Image of MNXM2400
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC12H18N2O8
charge-2
mass318.28
referencechebi:77826
InChIKeyGJRGEVKCJPPZIT-JBDRJPRFSA-L
InChIInChI=1S/C12H20N2O8/c15-7(11(19)20)1-3-13-9(12(21)22)8(16)5-14-4-2-6(14)10(17)18/h6-9,13,15-16H,1-5H2,(H,17,18)(H,19,20)(H,21,22)/p-2/t6-,7-,8-,9-/m0/s1
SMILESO[C@@H](CN1CC[C@H]1C([O-])=O)[C@H]([NH2+]CC[C@H](O)C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:77826
chebi:77826
mugineate
(2S)-1-[(2S,3S)-3-carboxylato-3-{[(3S)-3-carboxylato-3-hydroxypropyl]azaniumyl}-2-hydroxypropyl]azetidinium-2-carboxylate
mugineate(1-)
kegg.compound:C15500
keggC:C15500
Mugineic acid
seed.compound:cpd11182
seedM:cpd11182
Mugineic acid
mugineate
mugineic acid
CHEBI:58505
chebi:58505
mugineate(2-)
(2S)-1-[(2S,3S)-3-carboxylato-3-{[(3S)-3-carboxylato-3-hydroxypropyl]ammonio}-2-hydroxypropyl]azetidine-2-carboxylate
metacyc.compound:CPD-7231
metacycM:CPD-7231
mugineate
mugineic acid
CHEBI:25426
chebi:25426
mugineic acid
4-[(2S)-2-carboxyazetidin-1-yl]-N-[(3S)-3-carboxy-3-hydroxypropyl]-L-allothreonine
N-(3-(3-Carboxypropylamino)-2-hydroxy-3-carboxypropyl)azetidine-2-carboxylic acid
keggC:M_C15500
seedM:M_cpd11182
secondary/obsolete/fantasy identifier