Feedback

mugineate

Properties
MNX_IDMNXM2400
formulaC12H19N2O8
charge-1
mass319.28794
referencechebi:77826
Image of MNXM2400
InChIKeyGJRGEVKCJPPZIT-JBDRJPRFSA-M
InChIInChI=1S/C12H20N2O8/c15-7(11(19)20)1-3-13-9(12(21)22)8(16)5-14-4-2-6(14)10(17)18/h6-9,13,15-16H,1-5H2,(H,17,18)(H,19,20)(H,21,22)/p-1/t6-,7-,8-,9-/m0/s1
SMILESO[C@@H](C[NH+]1CC[C@H]1C([O-])=O)[C@H]([NH2+]CC[C@H](O)C([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:58505 mugineate(2-)
(2S)-1-[(2S,3S)-3-carboxylato-3-{[(3S)-3-carboxylato-3-hydroxypropyl]ammonio}-2-hydroxypropyl]azetidine-2-carboxylate
keggC:M_C15500
seedM:M_cpd11182
secondary/obsolete/fantasy identifier
metacycM:CPD-7231 mugineate
mugineic acid
chebi:77826 mugineate
(2S)-1-[(2S,3S)-3-carboxylato-3-{[(3S)-3-carboxylato-3-hydroxypropyl]azaniumyl}-2-hydroxypropyl]azetidinium-2-carboxylate
mugineate(1-)
chebi:25426 mugineic acid
4-[(2S)-2-carboxyazetidin-1-yl]-N-[(3S)-3-carboxy-3-hydroxypropyl]-L-allothreonine
N-(3-(3-Carboxypropylamino)-2-hydroxy-3-carboxypropyl)azetidine-2-carboxylic acid
keggC:C15500 Mugineic acid
seedM:cpd11182 Mugineic acid
mugineate
mugineic acid