|
![]() |
InChIKey | UFWIBTONFRDIAS-UHFFFAOYSA-N |
InChI | InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |
SMILES | c1ccc2ccccc2c1 |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 8 |
Distinct compatimentalized reactions in models | 3 |
Identifier | Description |
---|---|
seedM:cpd00618 | Naphthalene naphthalene |
hmdb:HMDB0029751 | Naphthalene Albocarbon Camphor tar Moth balls Moth flakes Mothballs Naftalen Naftaleno Naftalina Naphtalene Naphtaline Naphthalen Naphthalin Naphthaline Naphthene Tar camphor Tolboxane White tar naphthalene |
biggM:M_npthl chebi:14638 chebi:25469 chebi:44619 chebi:7472 hmdb:HMDB29751 keggC:M_C00829 seedM:M_cpd00618 | secondary/obsolete/fantasy identifier |
chebi:16482 | naphthalene NAPHTHALENE Naphthalen Naphthalene Naphthalin naftaleno naftalina naphtalene naphtaline |
envipath:...179a05a703ab | compound 43708 |
biggM:npthl envipath:...1ff226ac8cb4 keggC:C00829 sabiorkM:5258 | Naphthalene |
metacycM:NAPHTHALENE | naphthalene |
MNXM163871 | is deprecated and replaced by this entry |
MNXM724293 | is deprecated and replaced by this entry |