Feedback

 

D-glucuronate

Image of MNXM241
Properties
MNX_IDMNXM241
formulaC6H9O7
charge-1
mass193.132
referencechebi:58720
InChIKeyAEMOLEFTQBMNLQ-AQKNRBDQSA-M
InChIInChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/p-1/t1-,2-,3+,4-,6?/m0/s1
SMILESOC1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of D-glucuronate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:glcur D-Glucuronate
chebi:12975
chebi:15748
chebi:21013
D-Glucuronate
D-glucuronate
Glucuronate
chebi:4178 D-Glucuronsaeure
D-Glukuronsaeure
D-glucuronic acid
Glucuronic acid
chebi:47952 AEMOLEFTQBMNLQ-AQKNRBDQSA-N
D-glucopyranuronic acid
D-glucuronic acid
Glucuronate
Glucuronic acid
chebi:58720 (2S,3S,4S,5R)-3,4,5,6-tetrahydroxytetrahydro-2H-pyran-2-carboxylate
AEMOLEFTQBMNLQ-AQKNRBDQSA-M
D-glucopyranuronate
D-glucuronate
hmdb:HMDB00127 (2S,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid
D-Glucuronic acid
glucuronic acid
kegg:C00191 D-Glucuronate
Glucuronate
Glucuronic acid
kegg:C16245
seed:cpd19178
D-Glucuronic acid
metacyc:D-Glucopyranuronate D-Glucopyranuronate
D-glucopyranuronate
D-glucopyranuronic acid
metacyc:GLUCURONATE D-glucopyranuronic acid
D-glucuronate
D-glucuronic acid
GLUCURONATE
GlcA
glucuronate
glucuronic acid
reactome:1678868
reactome:2162232
reactome:5694569
D-glucuronate
D-glucuronic acid
GlcA
reactome:5661264 D-glucuronate
sabiork:1966 D-Glucuronate
D-Glucuronic acid
deprecated:MNXM162343
deprecated:MNXM507480
deprecated:MNXM860
deprecated:MNXM97018