Feedback

orsellinate

Properties
MNX_IDMNXM2411
formulaC8H7O4
charge-1
mass167.13878
referencechebi:16162
Image of MNXM2411
InChIKeyAMKYESDOVDKZKV-UHFFFAOYSA-M
InChIInChI=1S/C8H8O4/c1-4-2-5(9)3-6(10)7(4)8(11)12/h2-3,9-10H,1H3,(H,11,12)/p-1
SMILESCc1cc(O)cc(O)c1C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd01265 Orsellinate
2,4-Dihydroxy-6-methylbenzoate
2,4-Dihydroxy-6-methylbenzoic acid
2,4-dihydroxy-6-methylbenzoate
2,4-dihydroxy-6-methylbenzoic acid
4,6-Dihydroxy-o-toluic acid
4,6-dihydroxy-o-toluic acid
o-Orsellinic acid
o-orsellinic acid
orsellinate
chebi:16162 orsellinate
2,4-dihydroxy-6-methylbenzoate
o-orsellinate
chebi:11441
chebi:14700
chebi:25621
chebi:25724
chebi:7791
keggC:M_C01839
seedM:M_cpd01265
secondary/obsolete/fantasy identifier
chebi:32807 o-orsellinic acid
2,4-Dihydroxy-6-methylbenzoic acid
2,4-dihydroxy-6-methylbenzoic acid
4,6-Dihydroxy-o-toluic acid
Orsellinsaeure
o-Orsellinic acid
orsellic acid
orsellinic acid
lipidmaps:LMPK13010001 Orsellinic acid
keggC:C01839 Orsellinate
2,4-Dihydroxy-6-methylbenzoate
2,4-Dihydroxy-6-methylbenzoic acid
4,6-Dihydroxy-o-toluic acid
o-Orsellinic acid
metacycM:CPD-47 orsellinate
2,4-dihydroxy-6-methylbenzoate
2,4-dihydroxy-6-methylbenzoic acid
4,6-dihydroxy-o-toluic acid
o-orsellinic acid