Feedback

perillate

PropertiesImageOccurences in reactions
MNX_IDMNXM2414Image of MNXM2414
#reac
in my sandbox 0
in MNXref (generic)20
in models (compartimentalized) 4
formulaC10H13O2
charge-1
mass165.20902
referencechebi:62641
InChIKeyCDSMSBUVCWHORP-UHFFFAOYSA-M
InChIInChI=1S/C10H14O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h5,8H,1,3-4,6H2,2H3,(H,11,12)/p-1
SMILESCC(=C)C1CCC(=CC1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:62641
chebi:62641
perillate
4-(1-methylethenyl)-1-cyclohexene-1-carboxylate
4-(prop-1-en-2-yl)cyclohex-1-ene-1-carboxylate
4-isopropenylcyclohex-1-enecarboxylate
perillyl carboxylate
bigg.metabolite:peracd
biggM:peracd
envipath:...5167ec819549
envipathM:...5167ec819549
kegg.compound:C11924
keggC:C11924
lipidmaps:LMPR0102090041
lipidmapsM:LMPR0102090041
Perillic acid
hmdb:HMDB0004586 Perillic acid
4-(1-Methylethenyl)-1-cyclohexene-1-carboxylate
4-(1-Methylethenyl)-1-cyclohexene-1-carboxylic acid
4-(2-Propenyl)-1-cyclohexane-1-carboxylic acid
4-(prop-1-en-2-yl)cyclohex-1-ene-1-carboxylic acid
4-Isopropenylcyclohex-1-ene carboxylic acid
4-Isopropenylcyclohex-1-enecarboxylate
4-Isopropenylcyclohex-1-enecarboxylic acid
Perillate
perillic acid
seed.compound:cpd08721
seedM:cpd08721
Perillic acid
4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid
4-isopropenylcyclohex-1-enecarboxylic acid
CPD-12443
perillate
perillic acid
perillyl carboxylate
metacyc.compound:CPD-12443
metacycM:CPD-12443
perillate
4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid
4-isopropenylcyclohex-1-enecarboxylic acid
perillic acid
perillyl carboxylate
CHEBI:36999
chebi:36999
perillic acid
4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid
4-(prop-1-en-2-yl)cyclohex-1-ene-1-carboxylic acid
4-isopropenylcyclohex-1-enecarboxylic acid
Perillic acid
hmdb:HMDB0006539
hmdb:HMDB04586
hmdb:HMDB06539
chebi:25936
chebi:29661
biggM:M_peracd
keggC:M_C11924
seedM:M_cpd08721
secondary/obsolete/fantasy identifier