Feedback

perillate

Properties
MNX_IDMNXM2414
formulaC10H13O2
charge-1
mass165.20902
referencechebi:62641
Image of MNXM2414
InChIKeyCDSMSBUVCWHORP-UHFFFAOYSA-M
InChIInChI=1S/C10H14O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h5,8H,1,3-4,6H2,2H3,(H,11,12)/p-1
SMILESCC(=C)C1CCC(=CC1)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref20
Distinct compatimentalized reactions in models4

Similar chemical compounds in external resources
IdentifierDescription
biggM:M_peracd
chebi:25936
chebi:29661
hmdb:HMDB0006539
hmdb:HMDB04586
hmdb:HMDB06539
keggC:M_C11924
seedM:M_cpd08721
secondary/obsolete/fantasy identifier
metacycM:CPD-12443 perillate
4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid
4-isopropenylcyclohex-1-enecarboxylic acid
perillic acid
perillyl carboxylate
hmdb:HMDB0004586 Perillic acid
4-(1-Methylethenyl)-1-cyclohexene-1-carboxylate
4-(1-Methylethenyl)-1-cyclohexene-1-carboxylic acid
4-(2-Propenyl)-1-cyclohexane-1-carboxylic acid
4-(prop-1-en-2-yl)cyclohex-1-ene-1-carboxylic acid
4-Isopropenylcyclohex-1-ene carboxylic acid
4-Isopropenylcyclohex-1-enecarboxylate
4-Isopropenylcyclohex-1-enecarboxylic acid
Perillate
perillic acid
chebi:62641 perillate
4-(1-methylethenyl)-1-cyclohexene-1-carboxylate
4-(prop-1-en-2-yl)cyclohex-1-ene-1-carboxylate
4-isopropenylcyclohex-1-enecarboxylate
perillyl carboxylate
seedM:cpd08721 Perillic acid
4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid
4-isopropenylcyclohex-1-enecarboxylic acid
CPD-12443
perillate
perillic acid
perillyl carboxylate
chebi:36999 perillic acid
4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid
4-(prop-1-en-2-yl)cyclohex-1-ene-1-carboxylic acid
4-isopropenylcyclohex-1-enecarboxylic acid
Perillic acid
biggM:peracd
envipath:...5167ec819549
keggC:C11924
lipidmaps:LMPR0102090041
Perillic acid
MNXM165069is deprecated and replaced by this entry