Feedback

phenyl hydrogen sulfate

PropertiesImageOccurences in reactions
MNX_IDMNXM2415Image of MNXM2415
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC6H5O4S
charge-1
mass173.1675
referencechebi:27905
InChIKeyCTYRPMDGLDAWRQ-UHFFFAOYSA-M
InChIInChI=1S/C6H6O4S/c7-11(8,9)10-6-4-2-1-3-5-6/h1-5H,(H,7,8,9)/p-1
SMILES[O-]S(=O)(=O)Oc1ccccc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-158850
reactomeM:R-ALL-158850
CHEBI:27905
chebi:27905
phenyl hydrogen sulfate
Phenol sulfate
phenylsulfate
kegg.compound:C00850
keggC:C00850
Aryl sulfate
Phenol sulfate
seed.compound:cpd01471
seedM:cpd01471
Arylsulfate
Aryl sulfate
PHENYLSULFATE
Phenol sulfate
Phenylsulfate
phenol sulfate
phenyl sulfate
hmdb:HMDB0060015 Phenol sulphate
Aryl sulfuric acid
Aryl sulphate
Aryl sulphuric acid
Phenol sulfate
Phenol sulfuric acid
Phenol sulphuric acid
Phenylsulfate
Phenylsulfate, potassium salt
Phenylsulfate, sodium salt
Phenylsulfuric acid
Phenylsulphate
Phenylsulphuric acid
phenyloxidanesulfonic acid
phenylsulfate
kegg.compound:C02180
keggC:C02180
Phenylsulfate
Phenol sulfate
metacyc.compound:CPD-16821
metacycM:CPD-16821
phenyl sulfate
phenol sulfate
CHEBI:85289
chebi:85289
phenyl sulfate
phenyl sulfate(1-)
hmdb:HMDB60015
chebi:25967
chebi:8072
keggC:M_C00850
keggC:M_C02180
seedM:M_cpd01471
secondary/obsolete/fantasy identifier