Feedback

propynoate

Properties
MNX_IDMNXM2422
formulaC3HO2
charge-1
mass69.03884
referencechebi:15364
Image of MNXM2422
InChIKeyUORVCLMRJXCDCP-UHFFFAOYSA-M
InChIInChI=1S/C3H2O2/c1-2-3(4)5/h1H,(H,4,5)/p-1
SMILES[O-]C(=O)C#C

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models1

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd00598 Propynoate
Acetylenecarboxylic acid
Acetylenemonocarboxylate
Propiolic acid
acetylene monocarboxylic acid
propynoate
chebi:33199 propynoic acid
2-propynoic acid
Acetylenecarboxylic acid
HC#CCOOH
Propinsaeure
Propiolic acid
Propiolsaeure
acetylenic acid
carboxyacetylene
prop-2-ynoic acid
propargylic acid
propinic acid
hmdb:HMDB0006804 Propynoic acid
2-Propynoate
2-Propynoic acid
Acetylenate
Acetylenecarboxylate
Acetylenecarboxylic acid
Acetylenemonocarboxylate
Acetylenic acid
Carboxyacetylene
HC#ccooh
Propargylate
Propargylic acid
Propinate
Propinic acid
Propinsaeure
Propiolate
Propiolic acid
Propiolic acid, monosodium salt
Propiolsaeure
Propynoate
prop-2-ynoic acid
propiolic acid
keggC:C00804
sabiorkM:2162
Propynoate
Acetylenecarboxylic acid
Acetylenemonocarboxylate
Propiolic acid
metacycM:CPD-661 propynoate
Acetylenecarboxylic acid
Acetylenemonocarboxylate
Propiolic acid
acetylene monocarboxylic acid
chebi:15364 propynoate
Acetylenemonocarboxylate
Propiolat
acetylenecarboxylate
prop-2-ynoate
propiolate
chebi:14908
chebi:26303
chebi:26312
chebi:8503
hmdb:HMDB06804
keggC:M_C00804
seedM:M_cpd00598
secondary/obsolete/fantasy identifier