Feedback

propynoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2422Image of MNXM2422
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 1
formulaC3HO2
charge-1
mass68.9982
referencechebi:15364
InChIKeyUORVCLMRJXCDCP-UHFFFAOYSA-M
InChIInChI=1S/C3H2O2/c1-2-3(4)5/h1H,(H,4,5)/p-1
SMILESC#CC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15364
chebi:15364
propynoate
Acetylenemonocarboxylate
Propiolat
acetylenecarboxylate
prop-2-ynoate
propiolate
sabiork.compound:2162
sabiorkM:2162
kegg.compound:C00804
keggC:C00804
Propynoate
Acetylenecarboxylic acid
Acetylenemonocarboxylate
Propiolic acid
seed.compound:cpd00598
seedM:cpd00598
Propynoate
Acetylenecarboxylic acid
Acetylenemonocarboxylate
Propiolic acid
acetylene monocarboxylic acid
propynoate
hmdb:HMDB0006804 Propynoic acid
2-Propynoate
2-Propynoic acid
Acetylenate
Acetylenecarboxylate
Acetylenecarboxylic acid
Acetylenemonocarboxylate
Acetylenemonocarboxylic acid
Acetylenic acid
Carboxyacetylene
HC#ccooh
Propargylate
Propargylic acid
Propinate
Propinic acid
Propinsaeure
Propiolate
Propiolic acid
Propiolic acid, monosodium salt
Propiolsaeure
Propynoate
prop-2-ynoic acid
propiolic acid
metacyc.compound:CPD-661
metacycM:CPD-661
propynoate
Acetylenecarboxylic acid
Acetylenemonocarboxylate
Propiolic acid
acetylene monocarboxylic acid
CHEBI:33199
chebi:33199
propynoic acid
2-propynoic acid
Acetylenecarboxylic acid
HC#CCOOH
Propinsaeure
Propiolic acid
Propiolsaeure
acetylenic acid
carboxyacetylene
prop-2-ynoic acid
propargylic acid
propinic acid
hmdb:HMDB06804
chebi:14908
chebi:26303
chebi:26312
chebi:8503
keggC:M_C00804
seedM:M_cpd00598
secondary/obsolete/fantasy identifier