Feedback

3',5'-cyclic AMP

PropertiesImageOccurences in reactions
MNX_IDMNXM243Image of MNXM243
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 7
formulaC10H11N5O6P
charge-1
mass328.198201
referencechebi:58165
InChIKeyIVOMOUWHDPKRLL-KQYNXXCUSA-M
InChIInChI=1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/p-1/t4-,6-,7-,10-/m1/s1
SMILESNc1ncnc2n(cnc12)[C@@H]1O[C@@H]2COP([O-])(=O)O[C@H]2[C@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58165
chebi:58165
3',5'-cyclic AMP
3',5'-cyclic AMP anion
3',5'-cyclic AMP(1-)
adenosine 3',5'-cyclic monophosphate
adenosine 3',5'-cyclic monophosphate anion
adenosine 3',5'-cyclic monophosphate(1-)
adenosine 3',5'-phosphate
kegg.compound:C00575
keggC:C00575
3',5'-Cyclic AMP
Adenosine 3',5'-cyclic phosphate
Adenosine 3',5'-phosphate
Cyclic AMP
Cyclic adenylic acid
cAMP
sabiork.compound:1379
sabiorkM:1379
3',5'-Cyclic AMP
Adenosine 3',5'-phosphate
Cyclic AMP
Cyclic adenylic acid
cAMP
reactome:R-ALL-30389
reactomeM:R-ALL-30389
CHEBI:17489
chebi:17489
3',5'-cyclic AMP
3',5'-Cyclic AMP
ADENOSINE-3',5'-CYCLIC-MONOPHOSPHATE
Adenosine 3',5'-cyclic phosphate
Adenosine 3',5'-phosphate
Cyclic AMP
Cyclic adenylic acid
adenosine 3',5'-(hydrogen phosphate)
adenosine 3',5'-cyclic monophosphate
cAMP
bigg.metabolite:camp
biggM:camp
CAMP
hmdb:HMDB0000058 Cyclic AMP
(4aR,6R,7R,7aS)-6-(6-amino-9H-purin-9-yl)-2,7-dihydroxy-hexahydro-2lambda⁵-furo[3,2-d][1,3,2]dioxaphosphinin-2-one
3',5'-Monophosphate, adenosine cyclic
3'5'-Cyclic AMP
6-(6-amino-9H-Purin-9-yl)tetrahydro-4H-furo[3,2-D][1,3,2]dioxaphosphinine-2,7-diol 2-oxide
ADENOSINE-3',5'-cyclic-monophosphATE
ADENOSINE-3',5'-cyclic-monophosphoric acid
AMP, Cyclic
Acrasin
Adenosine 3',5'-cyclic monophosphate
Adenosine 3',5'-cyclic monophosphoric acid
Adenosine 3',5'-cyclic phosphate
Adenosine 3',5'-cyclic phosphoric acid
Adenosine 3',5'-cyclophosphate
Adenosine 3',5'-monophosphate
Adenosine 3',5'-phosphate
Adenosine 3',5'-phosphoric acid
Adenosine 3,5'-cyclic monophosphorate
Adenosine 3,5'-cyclic monophosphoric acid
Adenosine cyclic 3',5' monophosphate
Adenosine cyclic 3',5'-monophosphate
Adenosine cyclic 3,5 monophosphate
Adenosine cyclic monophosphate
Adenosine cyclic-3',5'-monophosphate
Adenosine cyclic-monophosphate
Adenosine-cyclic-phosphate
Adenosine-cyclic-phosphoric-acid
CAMP
Cyclic 3',5'-AMP
Cyclic 3',5'-adenylate
Cyclic 3',5'-adenylic acid
Cyclic 3',5'-monophosphate, adenosine
Cyclic AMP, (R)-isomer
Cyclic AMP, disodium salt
Cyclic AMP, monoammonium salt
Cyclic AMP, monopotassium salt
Cyclic AMP, monosodium salt
Cyclic AMP, sodium salt
Cyclic adenosine 3',5'-phosphate
Cyclic adenylate
Cyclic adenylic acid
Cyclic monophosphate, adenosine
Cyclic-3',5'-monophosphate, adenosine
Monophosphate, adenosine cyclic
cyclic adenosine monophosphate
seed.compound:cpd00446
seedM:cpd00446
cAMP
3',5'-Cyclic AMP
3',5'-cyclic AMP
Adenosine 3',5'-cyclic phosphate
Adenosine 3',5'-phosphate
Cyclic AMP
Cyclic adenylic acid
adenosine 3',5'-cyclic phosphate
adenosine cyclic-3',5'-monophosphate
adenosine cyclic-monophosphate
adenosine-3',5'-cyclic monophosphate
adenosine-3',5'-monophosphate
adenosine-cyclic-phosphate
adenosine-cyclic-phosphoric-acid
camp
cyclic 3',5'-AMP
cyclic-3',5'-adenosine monophosphate
cyclic-AMP
metacyc.compound:CAMP
metacycM:CAMP
cyclic-AMP
3',5'-cyclic AMP
adenosine 3',5'-cyclic phosphate
adenosine cyclic-3',5'-monophosphate
adenosine cyclic-monophosphate
adenosine-3',5'-cyclic monophosphate
adenosine-3',5'-monophosphate
adenosine-cyclic-phosphate
adenosine-cyclic-phosphoric-acid
cAMP
cyclic 3',5'-AMP
cyclic-3',5'-adenosine monophosphate
hmdb:HMDB00058
chebi:11673
chebi:1325
chebi:19827
chebi:41588
biggM:M_camp
keggC:M_C00575
seedM:M_cpd00446
secondary/obsolete/fantasy identifier