Feedback

trimethylsulfonium

PropertiesImageOccurences in reactions
MNX_IDMNXM2438Image of MNXM2438
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC3H9S
charge1
mass77.16956
referencechebi:17434
InChIKeyNRZWQKGABZFFKE-UHFFFAOYSA-N
InChIInChI=1S/C3H9S/c1-4(2)3/h1-3H3/q+1
SMILESC[S+](C)C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17434
chebi:17434
trimethylsulfonium
Trimethylsulfonium
hmdb:HMDB0012295 Trimethyl sulfonium
Trimethyl-sulfonium bromide
Trimethylsulfonium
Trimethylsulfonium bromide
Trimethylsulfonium chloride
Trimethylsulfonium hydroxide
Trimethylsulfonium iodide
Trimethylsulfonium nitrate
Trimethylsulphonium chloride
trimethylsulfanium
trimethylsulfonium
kegg.compound:C01008
keggC:C01008
Trimethylsulfonium
seed.compound:cpd00740
seedM:cpd00740
Trimethylsulfonium
trimethyl sulfonium
metacyc.compound:TRIMETHYLSULFONIUM
metacycM:TRIMETHYLSULFONIUM
trimethyl sulfonium
hmdb:HMDB12295
chebi:15265
chebi:27132
chebi:9736
keggC:M_C01008
seedM:M_cpd00740
secondary/obsolete/fantasy identifier