Feedback

(3R)-3-hydroxy-L-aspartate

Properties
MNX_IDMNXM2445
formulaC4H6NO5
charge-1
mass148.09418
referencechebi:58196
Image of MNXM2445
InChIKeyYYLQUHNPNCGKJQ-NHYDCYSISA-M
InChIInChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10)/p-1/t1-,2+/m0/s1
SMILES[NH3+][C@@H]([C@@H](O)C([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:33196 erythro-3-hydroxy-L-aspartate
(2S,3R)-2-amino-3-hydroxybutanedioate
(3R)-3-hydroxy-L-aspartate
(3R)-3-hydroxy-L-aspartate(2-)
erythro-3-Hydroxy-L-aspartate
erythro-3-hydroxy-Ls-aspartate
sabiorkM:6980 erythro-3-Hydroxy-L-aspartate
erythro-3-Hydroxy-L-aspartic acid
chebi:10557
chebi:12818
chebi:12819
chebi:21283
chebi:21287
chebi:48424
chebi:676808
keggC:M_C03961
seedM:M_cpd02458
secondary/obsolete/fantasy identifier
chebi:17576 (3R)-3-hydroxy-L-aspartic acid
(2S,3R)-2-amino-3-hydroxybutanedioic acid
(2S,3R)-2-amino-3-hydroxysuccinic acid
L-erythro-beta-hydroxyaspartic acid
erythro-3-Hydroxy-L-aspartate
erythro-3-Hydroxy-L-aspartic acid
erythro-3-Hydroxy-Ls-aspartic acid
erythro-beta-hydroxy-L-aspartic acid
chebi:58196 (3R)-3-hydroxy-L-aspartate
(2S,3R)-2-azaniumyl-3-hydroxybutanedioate
(3R)-3-hydroxy-L-aspartate anion
(3R)-3-hydroxy-L-aspartate(1-)
metacycM:CPD-655 (3R)-3-hydroxy-L-aspartate
L-erythro-3-hydroxyaspartate
L-erythro-beta-hydroxyaspartate
erythro-3-hydroxy-L-aspartate
erythro-3-hydroxy-aspartic acid
keggC:C03961 erythro-3-Hydroxy-Ls-aspartate
erythro-3-Hydroxy-L-aspartate
erythro-3-Hydroxy-L-aspartic acid
erythro-3-Hydroxy-Ls-aspartic acid
seedM:cpd02458 erythro-3-Hydroxy-L-aspartate
(3R)-3-hydroxy-L-aspartate
L-erythro-3-hydroxyaspartate
L-erythro-beta-hydroxyaspartate
erythro-3-Hydroxy-L-aspartic acid
erythro-3-Hydroxy-Ls-aspartate
erythro-3-Hydroxy-Ls-aspartic acid
erythro-3-hydroxy-L-aspartate
erythro-3-hydroxy-aspartic acid