Feedback

1,3-dihydroxy-N-methylacridone

Properties
MNX_IDMNXM2452
formulaC14H11NO3
charge0
mass241.24208
referencechebi:30306
Image of MNXM2452
InChIKeyGDALETGZDYOOGB-UHFFFAOYSA-N
InChIInChI=1S/C14H11NO3/c1-15-10-5-3-2-4-9(10)14(18)13-11(15)6-8(16)7-12(13)17/h2-7,16-17H,1H3
SMILESCn1c2ccccc2c(=O)c2c(O)cc(O)cc12

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref5
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:30306 1,3-dihydroxy-N-methylacridone
1,3-Dihydroxy-N-methyl-acridone
1,3-dihydroxy-10-methylacridin-9(10H)-one
keggC:C12093 1,3-Dihydroxy-N-methylacridone
seedM:cpd08877 1,3-Dihydroxy-N-methylacridone
1,3-dihydroxy-N-methylacridone
chebi:11167
chebi:29459
keggC:M_C12093
seedM:M_cpd08877
secondary/obsolete/fantasy identifier
metacycM:13-DIHYDROXY-N-METHYLACRIDONE 1,3-dihydroxy-N-methylacridone