Feedback

1,3-dihydroxy-N-methylacridone

PropertiesImageOccurences in reactions
MNX_IDMNXM2452Image of MNXM2452
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC14H11NO3
charge0
mass241.24208
referencechebi:30306
InChIKeyGDALETGZDYOOGB-UHFFFAOYSA-N
InChIInChI=1S/C14H11NO3/c1-15-10-5-3-2-4-9(10)14(18)13-11(15)6-8(16)7-12(13)17/h2-7,16-17H,1H3
SMILESCn1c2ccccc2c(=O)c2c(O)cc(O)cc12
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30306
chebi:30306
1,3-dihydroxy-N-methylacridone
1,3-Dihydroxy-N-methyl-acridone
1,3-dihydroxy-10-methylacridin-9(10H)-one
kegg.compound:C12093
keggC:C12093
1,3-Dihydroxy-N-methylacridone
seed.compound:cpd08877
seedM:cpd08877
1,3-Dihydroxy-N-methylacridone
1,3-dihydroxy-N-methylacridone
metacyc.compound:13-DIHYDROXY-N-METHYLACRIDONE
metacycM:13-DIHYDROXY-N-METHYLACRIDONE
1,3-dihydroxy-N-methylacridone
chebi:11167
chebi:29459
keggC:M_C12093
seedM:M_cpd08877
secondary/obsolete/fantasy identifier