Feedback

12-hydroxydodecanoate

Properties
MNX_IDMNXM2457
formulaC12H23O3
charge-1
mass215.30922
referencechebi:36204
Image of MNXM2457
InChIKeyZDHCZVWCTKTBRY-UHFFFAOYSA-M
InChIInChI=1S/C12H24O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h13H,1-11H2,(H,14,15)/p-1
SMILESOCCCCCCCCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
slm:000389676 12-hydroxydodecanate
12-hydroxylaurate
keggC:C08317
sabiorkM:10416
12-Hydroxydodecanoic acid
omega-Hydroxydodecanoic acid
lipidmaps:LMFA01050039 Sabinic acid
12-hydroxy lauric acid
12-hydroxy-dodecanoic acid
FA(12:0(OH))
seedM:cpd05232 12-Hydroxydodecanoic acid
12-hydroxydodecanoate
12-hydroxydodecanoic acid
12-hydroxylaurate
12-hydroxylauric acid
omega-Hydroxydodecanoic acid
omega-hydroxydodecanoic acid
omega-hydroxylaurate
omega-hydroxylauric acid
hmdb:HMDB0002059 12-Hydroxydodecanoic acid
12-Hydroxy laate
12-Hydroxy laic acid
12-Hydroxy lauric acid
12-Hydroxydodecanoate
12-Hydroxylaurate
12-Hydroxylauric acid
12-hydroxydodecanoic acid
2-Hydroxy-dodecanoate
2-Hydroxy-dodecanoic acid
Omega hydroxy dodecanoate
Omega hydroxy dodecanoic acid
Omega-OH dodecanoate
Omega-OH dodecanoic acid
Omega-OH laate
Omega-OH laic acid
Omega-OH lauric acid
Omega-hydroxy laate
Omega-hydroxy laic acid
Omega-hydroxy lauric acid
Omega-hydroxydodecanoate
Omega-hydroxydodecanoic acid
Omega-hydroxylauric acid
chebi:36204 12-hydroxydodecanoate
12-OH dodecanoate
12-OH laurate
12-hydroxylaurate
omega-OH dodecanoate
omega-hydroxy laurate
omega-hydroxydodecanoate
metacycM:CPD-12282 12-hydroxylaurate
12-hydroxydodecanoate
12-hydroxydodecanoic acid
12-hydroxylauric acid
omega-hydroxydodecanoic acid
omega-hydroxylaurate
omega-hydroxylauric acid
chebi:39567
reactome:R-ALL-42373
12-hydroxylauric acid
12-HYDROXYDODECANOIC ACID
12-Hydroxydodecanoic acid
12-hydroxy lauric acid
12-hydroxydodecanoic acid
2-hydroxy-dodecanoic acid
omega-Hydroxydodecanoic acid
omega-OH dodecanoic acid
omega-OH lauric acid
omega-hydroxy lauric acid
omega-hydroxydodecanoic acid
biggM:whddca Omega hydroxy dodecanoate (n-C12:0)
biggM:M_whddca
chebi:10616
chebi:39557
hmdb:HMDB02059
keggC:M_C08317
seedM:M_cpd05232
secondary/obsolete/fantasy identifier
MNXM12526is deprecated and replaced by this entry
MNXM90370is deprecated and replaced by this entry