Feedback

12-hydroxydodecanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2457Image of MNXM2457
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 7
formulaC12H23O3
charge-1
mass215.16527
referencechebi:36204
InChIKeyZDHCZVWCTKTBRY-UHFFFAOYSA-M
InChIInChI=1S/C12H24O3/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15/h13H,1-11H2,(H,14,15)/p-1
SMILESO=C([O-])CCCCCCCCCCCO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:36204
chebi:36204
12-hydroxydodecanoate
12-OH dodecanoate
12-OH laurate
12-hydroxylaurate
omega-OH dodecanoate
omega-hydroxy laurate
omega-hydroxydodecanoate
hmdb:HMDB0002059 12-Hydroxydodecanoic acid
12-Hydroxy laate
12-Hydroxy laic acid
12-Hydroxy lauric acid
12-Hydroxydodecanoate
12-Hydroxylaurate
12-Hydroxylauric acid
12-hydroxydodecanoic acid
2-Hydroxy-dodecanoate
2-Hydroxy-dodecanoic acid
Omega hydroxy dodecanoate
Omega hydroxy dodecanoic acid
Omega-OH dodecanoate
Omega-OH dodecanoic acid
Omega-OH laate
Omega-OH laic acid
Omega-OH lauric acid
Omega-hydroxy laate
Omega-hydroxy laic acid
Omega-hydroxy lauric acid
Omega-hydroxydodecanoate
Omega-hydroxydodecanoic acid
Omega-hydroxylauric acid
Sabinate
seed.compound:cpd05232
seedM:cpd05232
12-Hydroxydodecanoic acid
12-hydroxydodecanoate
12-hydroxydodecanoic acid
12-hydroxylaurate
12-hydroxylauric acid
omega-Hydroxydodecanoic acid
omega-hydroxydodecanoic acid
omega-hydroxylaurate
omega-hydroxylauric acid
sabiork.compound:10416
sabiorkM:10416
kegg.compound:C08317
keggC:C08317
12-Hydroxydodecanoic acid
omega-Hydroxydodecanoic acid
SLM:000389676
slm:000389676
12-hydroxydodecanate
12-hydroxylaurate
metacyc.compound:CPD-12282
metacycM:CPD-12282
12-hydroxylaurate
12-hydroxydodecanoate
12-hydroxydodecanoic acid
12-hydroxylauric acid
omega-hydroxydodecanoic acid
omega-hydroxylaurate
omega-hydroxylauric acid
reactome:R-ALL-42373
reactomeM:R-ALL-42373
CHEBI:39567
chebi:39567
12-hydroxylauric acid
12-HYDROXYDODECANOIC ACID
12-Hydroxydodecanoic acid
12-hydroxy lauric acid
12-hydroxydodecanoic acid
2-hydroxy-dodecanoic acid
omega-Hydroxydodecanoic acid
omega-OH dodecanoic acid
omega-OH lauric acid
omega-hydroxy lauric acid
omega-hydroxydodecanoic acid
bigg.metabolite:whddca
biggM:whddca
Omega hydroxy dodecanoate (n-C12:0)
lipidmaps:LMFA01050039
lipidmapsM:LMFA01050039
Sabinic acid
12-hydroxy lauric acid
12-hydroxy-dodecanoic acid
FA 12:0
O
hmdb:HMDB02059
chebi:10616
chebi:39557
biggM:M_whddca
keggC:M_C08317
seedM:M_cpd05232
secondary/obsolete/fantasy identifier