Feedback

15-oxo-(5Z,8Z,11Z,13E)-eicosatetraenoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2458Image of MNXM2458
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC20H29O3
charge-1
mass317.44246
referencechebi:57410
InChIKeyYGJTUEISKATQSM-USWFWKISSA-M
InChIInChI=1S/C20H30O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h4-5,8-11,14,17H,2-3,6-7,12-13,15-16,18H2,1H3,(H,22,23)/p-1/b5-4-,10-8-,11-9-,17-14+
SMILESCCCCCC(=O)\C=C\C=C/C\C=C/C\C=C/CCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57410
chebi:57410
15-oxo-(5Z,8Z,11Z,13E)-eicosatetraenoate
(5Z,8Z,11Z,13E)-15-ketoeicosa-5,8,11,13-tetraenoate
(5Z,8Z,11Z,13E)-15-oxo-5,8,11,13-eicosatetraenoate
(5Z,8Z,11Z,13E)-15-oxoeicosa-5,8,11,13-tetraenoate
(5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate
15-oxo-5,8,11-cis-13-trans-eicosatetraenoate
15-oxo-ETE(1-)
hmdb:HMDB0010210 15-KETE
(5Z,8Z,11Z,13E)-15-Ketoeicosa-5,8,11,13-tetraenoate
(5Z,8Z,11Z,13E)-15-Ketoeicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E)-15-Oxoeicosa-5,8,11,13-tetraenoate
(5Z,8Z,11Z,13E)-15-Oxoeicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E)-15-Oxoicosa-5,8,11,13-tetraenoate
(5Z,8Z,11Z,13E)-15-Oxoicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E)-15-oxo-5,8,11,13-Eicosatetraenoate
(5Z,8Z,11Z,13E)-15-oxo-5,8,11,13-Eicosatetraenoic acid
(5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoic acid
15-Oxo-ETE
15-OxoETE
15-keto-5,8,11,13-Eicosatetraenoic acid
15-oxo-5,8,11-cis-13-trans-Eicosatetraenoate
15-oxo-5,8,11-cis-13-trans-Eicosatetraenoic acid
15-oxo-5,8,11-cis-13-trans-Icosatetraenoate
15-oxo-5,8,11-cis-13-trans-Icosatetraenoic acid
15-oxo-5Z,8Z,11Z,13E-Eicosatetraenoate
15-oxo-5Z,8Z,11Z,13E-Eicosatetraenoic acid
15-oxo-ETE
metacyc.compound:15-OXO-5811-CIS-13-TRANS-ICOSATETRAENO
metacycM:15-OXO-5811-CIS-13-TRANS-ICOSATETRAENO
15-KETE
15-oxo-5,8,11-cis-13-trans-icosatetraenoate
lipidmaps:LMFA03060051
lipidmapsM:LMFA03060051
15-Oxo-ETE
15-oxo-5Z,8Z,11Z,13E-eicosatetraenoic acid
FA(20:4(Ke))
seed.compound:cpd02786
seedM:cpd02786
15-OxoETE
(5Z,8Z,11Z,13E)-15-Oxoicosa-5,8,11,13-tetraenoic acid
15-KETE
15-Oxo-5,8,11-cis-13-trans-eicosatetraenoate
15-Oxo-5,8,11-cis-13-trans-icosatetraenoate
15-oxo-5,8,11-cis-13-trans-icosatetraenoate
kegg.compound:C04577
keggC:C04577
15-OxoETE
(5Z,8Z,11Z,13E)-15-Oxoicosa-5,8,11,13-tetraenoic acid
15-Oxo-5,8,11-cis-13-trans-eicosatetraenoate
15-Oxo-5,8,11-cis-13-trans-icosatetraenoate
SLM:000500470
slm:000500470
15-oxo-(5Z,8Z,11Z,13E)-eicosatetraenoate
15-KETE
15-kete-ETE
15-keto-(5Z,8Z,11Z,13E)-ETE
15-keto-(5Z,8Z,11Z,13E)-eicosatetraenoate
15-oxo-(5Z,8Z,11Z,13E)-ETE
15-oxo-ETE
reactome:R-ALL-2142747
reactomeM:R-ALL-2142747
CHEBI:15559
chebi:15559
15-oxo-ETE
(5Z,8Z,11Z,13E)-15-Oxoicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E)-15-ketoeicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E)-15-oxo-5,8,11,13-eicosatetraenoic acid
(5Z,8Z,11Z,13E)-15-oxoeicosa-5,8,11,13-tetraenoic acid
(5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoic acid
15-Kete
15-Oxo-5,8,11-cis-13-trans-eicosatetraenoate
15-Oxo-ETE
15-OxoETE
hmdb:HMDB10210
chebi:11326
chebi:19155
chebi:761
keggC:M_C04577
seedM:M_cpd02786
secondary/obsolete/fantasy identifier