Feedback

16-hydroxyhexadecanoate

Properties
MNX_IDMNXM2459
formulaC16H31O3
charge-1
mass271.41554
referencechebi:55329
Image of MNXM2459
InChIKeyUGAGPNKCDRTDHP-UHFFFAOYSA-M
InChIInChI=1S/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19)/p-1
SMILESOCCCCCCCCCCCCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref17
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
lipidmaps:LMFA01050051 Juniperic acid
16-hydroxy-hexadecanoic acid
FA(16:0(OH))
Juniperinic acid
sabiorkM:23374 16-Hydroxyhexadecanoic acid
16-Hydroxypalmitate
biggM:whhdca Omega hydroxy hexadecanoate (n-C16:0)
seedM:cpd19486 16-Hydroxypalmitate
16-Hydroxypalmitic acid
16-hydroxy-hexadecanoate
16-hydroxypalmitate
omega-hydroxy-hexadecanoate
omega-hydroxy-palmitate
hmdb:HMDB0006294 16-Hydroxy hexadecanoic acid
16-Hydroxy-hexadecanoate
16-Hydroxyhexadecanoate
16-Hydroxyhexadecanoic acid
16-Hydroxypalmitate
16-Hydroxypalmitic acid
16-OH 16:0
16-hydroxyhexadecanoic acid
Omega-hydroxypalmitate
Omega-hydroxypalmitic acid
biggM:M_whhdca
hmdb:HMDB06294
keggC:M_C18218
seedM:M_cpd19486
secondary/obsolete/fantasy identifier
chebi:55328 16-hydroxyhexadecanoic acid
16-Hydroxyhexadecanoic acid
16-Hydroxypalmitic acid
16-OH 16:0
16-hydroxy-hexadecanoic acid
16-hydroxypalmitic acid
juniperic acid
omega-hydroxypalmitic acid
chebi:55329
slm:000389680
16-hydroxyhexadecanoate
16-hydroxypalmitate
keggC:C18218 16-Hydroxypalmitate
16-Hydroxypalmitic acid
metacycM:16-HYDROXYPALMITATE 16-hydroxypalmitate
16-hydroxy-hexadecanoate
juniperate
omega-hydroxy-hexadecanoate
omega-hydroxy-palmitate
MNXM163605is deprecated and replaced by this entry