Feedback

16-hydroxyhexadecanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM2459Image of MNXM2459
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 12
formulaC16H31O3
charge-1
mass271.22787
referencechebi:55329
InChIKeyUGAGPNKCDRTDHP-UHFFFAOYSA-M
InChIInChI=1S/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19)/p-1
SMILESO=C([O-])CCCCCCCCCCCCCCCO
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:55329
chebi:55329
SLM:000389680
slm:000389680
16-hydroxyhexadecanoate
16-hydroxypalmitate
hmdb:HMDB0006294 16-Hydroxy hexadecanoic acid
16-Hydroxy hexadecanoate
16-Hydroxy-hexadecanoate
16-Hydroxy-hexadecanoic acid
16-Hydroxyhexadecanoate
16-Hydroxyhexadecanoic acid
16-Hydroxypalmitate
16-Hydroxypalmitic acid
16-OH 16:0
16-hydroxyhexadecanoic acid
Juniperate
Omega-hydroxypalmitate
Omega-hydroxypalmitic acid
sabiork.compound:23374
sabiorkM:23374
16-Hydroxyhexadecanoic acid
16-Hydroxypalmitate
kegg.compound:C18218
keggC:C18218
16-Hydroxypalmitate
16-Hydroxypalmitic acid
seed.compound:cpd19486
seedM:cpd19486
16-Hydroxypalmitate
16-Hydroxypalmitic acid
16-hydroxy-hexadecanoate
16-hydroxypalmitate
omega-hydroxy-hexadecanoate
omega-hydroxy-palmitate
CHEBI:55328
chebi:55328
16-hydroxyhexadecanoic acid
16-Hydroxyhexadecanoic acid
16-Hydroxypalmitic acid
16-OH 16:0
16-hydroxy-hexadecanoic acid
16-hydroxypalmitic acid
juniperic acid
omega-hydroxypalmitic acid
metacyc.compound:16-HYDROXYPALMITATE
metacycM:16-HYDROXYPALMITATE
16-hydroxypalmitate
16-hydroxy-hexadecanoate
16-hydroxy-hexadecanoic acid
juniperate
omega-hydroxy-hexadecanoate
omega-hydroxy-palmitate
lipidmaps:LMFA01050051
lipidmapsM:LMFA01050051
Juniperic acid
16-hydroxy-hexadecanoic acid
FA 16:0
Juniperinic acid
O
bigg.metabolite:whhdca
biggM:whhdca
Omega hydroxy hexadecanoate (n-C16:0)
hmdb:HMDB06294
biggM:M_whhdca
keggC:M_C18218
seedM:M_cpd19486
secondary/obsolete/fantasy identifier