Feedback

(2E,4E)-2,4-dichloromuconate

PropertiesImageOccurences in reactions
MNX_IDMNXM2464Image of MNXM2464
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC6H2Cl2O4
charge-2
mass208.98308
referencechebi:11438
InChIKeyFHXOPKKNGKBBKG-DXLKSGPOSA-L
InChIInChI=1S/C6H4Cl2O4/c7-3(2-5(9)10)1-4(8)6(11)12/h1-2H,(H,9,10)(H,11,12)/p-2/b3-2+,4-1+
SMILES[O-]C(=O)\C=C(\Cl)/C=C(/Cl)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:11438
chebi:11438
(2E,4E)-2,4-dichloromuconate
(2E,4E)-2,4-dichlorohexa-2,4-dienedioate
2,4-dichloro-cis,cis-muconate(2-)
sabiork.compound:6947
sabiorkM:6947
envipath:...eba511dc6d31
envipathM:...eba511dc6d31
kegg.compound:C03918
keggC:C03918
2,4-Dichloro-cis,cis-muconate
seed.compound:cpd02436
seedM:cpd02436
2,4-Dichloro-cis,cis-muconate
2,4-dichloro-cis,cis-muconate
metacyc.compound:CPD-10632
metacycM:CPD-10632
2,4-dichloro-cis,cis-muconate
lipidmaps:LMFA01090151
lipidmapsM:LMFA01090151
2,4-dichloro-cis,cis-muconic acid
(2E,4E)-2,4-dichlorohexa-2,4-dienedioic acid
(E,E)-2,4-dichloro-2,4-hexadienedioic acid
CHEBI:17365
chebi:17365
2,4-dichloro-cis,cis-muconic acid
(2E,4E)-2,4-dichlorohexa-2,4-dienedioic acid
(E,E)-2,4-dichloro-2,4-hexadienedioic acid
2,4-Dichloro-cis,cis-muconate
chebi:19346
chebi:906
keggC:M_C03918
seedM:M_cpd02436
secondary/obsolete/fantasy identifier