Feedback

2,6-dichlorohydroquinone

PropertiesImageOccurences in reactions
MNX_IDMNXM2466Image of MNXM2466
#reac
in my sandbox 0
in MNXref (generic)15
in models (compartimentalized) 0
formulaC6H3Cl2O2
charge-1
mass176.95156
referencechebi:141024
InChIKeyQQAHQUBHRBQWBL-UHFFFAOYSA-M
InChIInChI=1S/C6H4Cl2O2/c7-4-1-3(9)2-5(8)6(4)10/h1-2,9-10H/p-1
SMILES[O-]c1c(Cl)cc(O)cc1Cl
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:141024
chebi:141024
2,6-dichlorohydroquinone
2,6-dichloro-4-hydroxyphenolate
kegg.compound:C07097
keggC:C07097
2,6-Dichlorohydroquinone
envipath:...c5a376d921e6
envipathM:...c5a376d921e6
2,6-Dichlorohydroquinone (DiCH)
seed.compound:cpd04372
seedM:cpd04372
2,6-Dichlorohydroquinone
2,6-DiCH
2,6-dichloro-p-hydroquinone
2,6-dichlorohydroquinone
DiCH
metacyc.compound:26-DICHLORO-P-HYDROQUINONE
metacycM:26-DICHLORO-P-HYDROQUINONE
2,6-dichlorohydroquinone
2,6-DiCH
2,6-dichloro-p-hydroquinone
DiCH
CHEBI:27633
chebi:27633
2,6-dichlorohydroquinone
2,6-dichloro-1,4-benzenediol
2,6-dichloro-4-hydroquinone
2,6-dichlorobenzene-1,4-diol
chebi:19394
chebi:944
keggC:M_C07097
seedM:M_cpd04372
secondary/obsolete/fantasy identifier