Feedback

2-amino-2-deoxy-D-gluconate

PropertiesImageOccurences in reactions
MNX_IDMNXM2469Image of MNXM2469
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 2
formulaC6H13NO6
charge0
mass195.17056
referencechebi:58269
InChIKeyUFYKDFXCZBTLOO-TXICZTDVSA-N
InChIInChI=1S/C6H13NO6/c7-3(6(12)13)5(11)4(10)2(9)1-8/h2-5,8-11H,1,7H2,(H,12,13)/t2-,3-,4-,5-/m1/s1
SMILES[NH3+][C@H]([C@@H](O)[C@H](O)[C@H](O)CO)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58269
chebi:58269
2-amino-2-deoxy-D-gluconate
2-amino-2-deoxy-D-gluconic acid zwitterion
2-ammonio-2-deoxy-D-gluconate
2-azaniumyl-2-deoxy-D-gluconate
kegg.compound:C03752
keggC:C03752
2-Amino-2-deoxy-D-gluconate
D-Glucosaminate
D-Glucosaminic acid
Glucosaminate
CHEBI:33805
chebi:33805
2-amino-2-deoxy-D-gluconate
(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanoate
metacyc.compound:GLUCOSAMINATE
metacycM:GLUCOSAMINATE
2-amino-2-deoxy-D-gluconate
2-amino-2-deoxy-D-gluconic acid
D-glucosaminate
D-glucosaminic acid
CHEBI:17784
chebi:17784
2-amino-2-deoxy-D-gluconic acid
(3R,4S,5R)-3,4,5,6-tetrahydroxy-D-norleucine
2-Amino-2-deoxy-D-gluconate
D-Glucosaminate
D-Glucosaminic acid
D-glucosaminate
Glucosaminate
seed.compound:cpd02351
seedM:cpd02351
Glucosaminate
2-Amino-2-deoxy-D-gluconate
2-amino-2-deoxy-D-gluconate
2-amino-2-deoxy-D-gluconic acid
D-Glucosaminate
D-Glucosaminic acid
D-glucosaminate
D-glucosaminic acid
glucosaminate
chebi:11503
chebi:12960
chebi:19444
chebi:20991
chebi:20992
chebi:20996
chebi:990
keggC:M_C03752
seedM:M_cpd02351
secondary/obsolete/fantasy identifier