Feedback

2-amino-2-deoxy-D-gluconate

Properties
MNX_IDMNXM2469
formulaC6H13NO6
charge0
mass195.17056
referencechebi:58269
Image of MNXM2469
InChIKeyUFYKDFXCZBTLOO-TXICZTDVSA-N
InChIInChI=1S/C6H13NO6/c7-3(6(12)13)5(11)4(10)2(9)1-8/h2-5,8-11H,1,7H2,(H,12,13)/t2-,3-,4-,5-/m1/s1
SMILES[NH3+][C@H]([C@@H](O)[C@H](O)[C@H](O)CO)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models2

Similar chemical compounds in external resources
IdentifierDescription
chebi:17784 2-amino-2-deoxy-D-gluconic acid
(3R,4S,5R)-3,4,5,6-tetrahydroxy-D-norleucine
2-Amino-2-deoxy-D-gluconate
D-Glucosaminate
D-Glucosaminic acid
D-glucosaminate
Glucosaminate
seedM:cpd02351 Glucosaminate
2-Amino-2-deoxy-D-gluconate
2-amino-2-deoxy-D-gluconate
2-amino-2-deoxy-D-gluconic acid
D-Glucosaminate
D-Glucosaminic acid
D-glucosaminate
D-glucosaminic acid
glucosaminate
chebi:33805 2-amino-2-deoxy-D-gluconate
(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanoate
metacycM:GLUCOSAMINATE 2-amino-2-deoxy-D-gluconate
2-amino-2-deoxy-D-gluconic acid
D-glucosaminate
D-glucosaminic acid
chebi:58269 2-amino-2-deoxy-D-gluconate
2-amino-2-deoxy-D-gluconic acid zwitterion
2-ammonio-2-deoxy-D-gluconate
2-azaniumyl-2-deoxy-D-gluconate
keggC:C03752 2-Amino-2-deoxy-D-gluconate
D-Glucosaminate
D-Glucosaminic acid
Glucosaminate
chebi:11503
chebi:12960
chebi:19444
chebi:20991
chebi:20992
chebi:20996
chebi:990
keggC:M_C03752
seedM:M_cpd02351
secondary/obsolete/fantasy identifier