Feedback

3,4-dehydrothiomorpholine-3-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM2480Image of MNXM2480
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC5H6NO2S
charge-1
mass144.17268
referencechebi:58517
InChIKeyHRXJCQXGAHSUJC-UHFFFAOYSA-M
InChIInChI=1S/C5H7NO2S/c7-5(8)4-3-9-2-1-6-4/h1-3H2,(H,7,8)/p-1
SMILES[O-]C(=O)C1=NCCSC1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
metacyc.compound:34-DEHYDRO-14-THIOMORPHOLINE-3-CARBOXY
metacycM:34-DEHYDRO-14-THIOMORPHOLINE-3-CARBOXY
CHEBI:58517
chebi:58517
3,4-dehydrothiomorpholine-3-carboxylate
5,6-dihydro-2H-1,4-thiazine-3-carboxylate
kegg.compound:C04445
keggC:C04445
3,4-Dehydrothiomorpholine-3-carboxylate
seed.compound:cpd02714
seedM:cpd02714
3,4-Dehydrothiomorpholine-3-carboxylate
3,4-dehydrothiomorpholine-3-carboxylate
5,6-dihydro-2H-1,4-thiazine-3-carboxylate
CHEBI:27626
chebi:27626
3,4-dehydrothiomorpholine-3-carboxylic acid
3,4-Dehydrothiomorpholine-3-carboxylate
3,4-dehydro-1,4-thiomorpholine-3-carboxylate
3,4-dehydrothiomorpholine-3-carboxylate
5,6-dihydro-2H-1,4-thiazine-3-carboxylic acid
chebi:11687
chebi:1370
chebi:19871
keggC:M_C04445
seedM:M_cpd02714
secondary/obsolete/fantasy identifier