Feedback

3-sulfinylpyruvic acid

Properties
MNX_IDMNXM2484
formulaC3H4O5S
charge0
mass152.12686
referencechebi:1665
Image of MNXM2484
InChIKeyJXYLQEMXCAAMOL-UHFFFAOYSA-N
InChIInChI=1S/C3H4O5S/c4-2(3(5)6)1-9(7)8/h1H2,(H,5,6)(H,7,8)
SMILESOC(=O)C(=O)CS(O)=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models4

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd03284 3-Sulfinopyruvate
3-Sulfinylpyruvate
3-sulfinopyruvate
3-sulfinyl-pyruvate
3-sulphinyl-pyruvate
beta-sulfinylpyruvate
biggM:M_3snpyr
hmdb:HMDB01405
hmdb:HMDB02332
keggC:M_C05527
seedM:M_cpd03284
secondary/obsolete/fantasy identifier
chebi:1665 3-sulfinylpyruvic acid
2-oxo-3-sulfinopropanoic acid
3-Sulfinopyruvate
3-Sulfinylpyruvate
chebi:140699 3-sulfinatopyruvate(2-)
2-oxo-3-sulfinatopropanoate
3-sulfinatopyruvate
hmdb:HMDB0001405 3-Sulfinylpyruvic acid
2-oxo-3-sulfinopropanoic acid
3-Sulfinopyruvate
3-Sulfinopyruvic acid
3-Sulfinylpyruvate
3-Sulphinopyruvate
3-Sulphinopyruvic acid
3-Sulphinylpyruvate
3-Sulphinylpyruvic acid
3-sulfinylpyruvate
b-Sulfinyl pyruvic acid
b-Sulphinyl pyruvate
b-Sulphinyl pyruvic acid
beta-Sulfinyl pyruvate
beta-Sulfinyl pyruvic acid
beta-Sulfinyl- pyruvate
biggM:3snpyr 3-Sulfinopyruvate
keggC:C05527
sabiorkM:2799
3-Sulfinylpyruvate
3-Sulfinopyruvate
metacycM:3-SULFINYL-PYRUVATE 3-sulfinopyruvate
3-sulfinyl-pyruvate
3-sulphinyl-pyruvate
beta-sulfinylpyruvate
hmdb:HMDB0002332 B-Sulfinyl pyruvate
2-oxo-3-sulfinopropanoic acid
3-Sulfinopyruvate
3-Sulfinopyruvic acid
3-Sulfinylpyruvate
3-Sulfinylpyruvic acid
3-Sulphinopyruvate
3-Sulphinopyruvic acid
3-Sulphinylpyruvate
3-Sulphinylpyruvic acid
3-sulfinylpyruvate
b-Sulfinyl pyruvic acid
b-Sulphinyl pyruvate
b-Sulphinyl pyruvic acid
beta-Sulfinyl pyruvate
beta-Sulfinyl pyruvic acid
beta-Sulfinyl- pyruvate
MNXM162632is deprecated and replaced by this entry
MNXM491700is deprecated and replaced by this entry