Feedback

3-sulfinylpyruvic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM2484Image of MNXM2484
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 4
formulaC3H2O5S
charge-2
mass150.11098
referencechebi:1665
InChIKeyJXYLQEMXCAAMOL-UHFFFAOYSA-L
InChIInChI=1S/C3H4O5S/c4-2(3(5)6)1-9(7)8/h1H2,(H,5,6)(H,7,8)/p-2
SMILES[O-]C(=O)C(=O)CS([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:1665
chebi:1665
3-sulfinylpyruvic acid
2-oxo-3-sulfinopropanoic acid
3-Sulfinopyruvate
3-Sulfinylpyruvate
bigg.metabolite:3snpyr
biggM:3snpyr
3-Sulfinopyruvate
seed.compound:cpd03284
seedM:cpd03284
3-Sulfinopyruvate
3-Sulfinylpyruvate
3-sulfinopyruvate
3-sulfinyl-pyruvate
3-sulphinyl-pyruvate
beta-sulfinylpyruvate
sabiork.compound:2799
sabiorkM:2799
kegg.compound:C05527
keggC:C05527
3-Sulfinylpyruvate
3-Sulfinopyruvate
hmdb:HMDB0001405 3-Sulfinylpyruvic acid
2-oxo-3-sulfinopropanoic acid
3-Sulfinopyruvate
3-Sulfinopyruvic acid
3-Sulfinylpyruvate
3-Sulphinopyruvate
3-Sulphinopyruvic acid
3-Sulphinylpyruvate
3-Sulphinylpyruvic acid
3-sulfinylpyruvate
b-Sulfinyl pyruvic acid
b-Sulphinyl pyruvate
b-Sulphinyl pyruvic acid
beta-Sulfinyl pyruvate
beta-Sulfinyl pyruvic acid
beta-Sulfinyl- pyruvate
CHEBI:140699
chebi:140699
3-sulfinatopyruvate(2-)
2-oxo-3-sulfinatopropanoate
3-sulfinatopyruvate
metacyc.compound:3-SULFINYL-PYRUVATE
metacycM:3-SULFINYL-PYRUVATE
3-sulfinopyruvate
3-sulfinyl-pyruvate
3-sulphinyl-pyruvate
beta-sulfinylpyruvate
hmdb:HMDB0002332 B-Sulfinyl pyruvate
2-oxo-3-sulfinopropanoic acid
3-Sulfinopyruvate
3-Sulfinopyruvic acid
3-Sulfinylpyruvate
3-Sulfinylpyruvic acid
3-Sulphinopyruvate
3-Sulphinopyruvic acid
3-Sulphinylpyruvate
3-Sulphinylpyruvic acid
3-sulfinylpyruvate
b-Sulfinyl pyruvic acid
b-Sulphinyl pyruvate
b-Sulphinyl pyruvic acid
beta-Sulfinyl pyruvate
beta-Sulfinyl pyruvic acid
beta-Sulfinyl- pyruvate
hmdb:HMDB01405
hmdb:HMDB02332
biggM:M_3snpyr
keggC:M_C05527
seedM:M_cpd03284
secondary/obsolete/fantasy identifier