Feedback

6-aminopenicillanate

PropertiesImageOccurences in reactions
MNX_IDMNXM2495Image of MNXM2495
#reac
in my sandbox 0
in MNXref (generic)16
in models (compartimentalized) 3
formulaC8H12N2O3S
charge0
mass216.25856
referencechebi:57869
InChIKeyNGHVIOIJCVXTGV-ALEPSDHESA-N
InChIInChI=1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1
SMILESCC1(C)S[C@@H]2[C@H]([NH3+])C(=O)N2[C@H]1C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57869
chebi:57869
6-aminopenicillanate
(2S,5R,6R)-6-azaniumyl-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate
6-aminopenicillanic acid zwitterion
6-azaniumyl-2,2-dimethylpenam-3alpha-carboxylate
bigg.metabolite:6ampenc
biggM:6ampenc
6 Aminopenicillanate
bigg.metabolite:6apa
biggM:6apa
6 Aminopenicillanic acid
seed.compound:cpd01896
seedM:cpd01896
6-Aminopenicillanate
6-APA
6-Aminopenicillanic acid
6-aminopenicillanate
6ampenc
sabiork.compound:2606
sabiorkM:2606
kegg.compound:C02954
keggC:C02954
6-Aminopenicillanate
6-Aminopenicillanic acid
hmdb:HMDB0060618 6-Aminopenicillanic acid
(+)-6-Aminopenicillanate
(+)-6-Aminopenicillanic acid
(2S,5R,6R)-6-amino-3,3-Dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate
(2S,5R,6R)-6-amino-3,3-Dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
(2S,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
6-APA
6-APA CPD
6-Aminopenicillamine acid
6-Aminopenicillanate
6-Aps
6b-Aminopenicillanate
6b-Aminopenicillanic acid
6beta-Aminopenicillanate
6beta-Aminopenicillanic acid
6beta-aminopenicillanate
6beta-aminopenicillanic acid
Aminopenicillanate
Aminopenicillanic acid
Aminopenicillanic acid, potassium salt
Aminopenicillanic acid, sodium salt
Penicin
Penin
Phenacyl 6-aminopenicillinate
Phenacyl 6-aminopenicillinic acid
penin
CHEBI:30938
chebi:30938
6-aminopenicillanate
(2S,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate
metacyc.compound:6-AMINOPENICILLANATE
metacycM:6-AMINOPENICILLANATE
6-aminopenicillanate
6-APA
6-Aminopenicillanic acid
CHEBI:16705
chebi:16705
6-aminopenicillanic acid
(+)-6-aminopenicillanic acid
(2S,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
6-APA
6-Aminopenicillamine acid
6-Aminopenicillanate
6-Aminopenicillanic acid
6-Apa
6-Aps
6-amino-2,2-dimethylpenam-3alpha-carboxylic acid
6beta-aminopenicillanic acid
Aminopenicillanic acid
Penicin
Penin
Phenacyl 6-aminopenicillinate
hmdb:HMDB60618
chebi:12207
chebi:20704
chebi:20705
chebi:2172
biggM:M_6ampenc
biggM:M_6apa
keggC:M_C02954
seedM:M_cpd01896
secondary/obsolete/fantasy identifier